Licocoumarin A
Internal ID | e81cdbc4-f99c-4137-b3d0-36b3047f097f |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Hydroxyisoflavonoids |
IUPAC Name | 3-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC(=C1O)C2=CC3=C(C(=C(C=C3)O)CC=C(C)C)OC2=O)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC(=C1O)C2=CC3=C(C(=C(C=C3)O)CC=C(C)C)OC2=O)O)C |
InChI | InChI=1S/C25H26O5/c1-14(2)5-8-18-21(26)12-10-17(23(18)28)20-13-16-7-11-22(27)19(9-6-15(3)4)24(16)30-25(20)29/h5-7,10-13,26-28H,8-9H2,1-4H3 |
InChI Key | UAGJZOLUSRCDEP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H26O5 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 6.30 |
3-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-7-hydroxy-8-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
3-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one |
CHEBI:175257 |
7,2'4'-Trihydroxy-8,3'-diprenyl-3-phenylcoumarin |
2H-1-benzopyran-2-one, 3-[2,4-dihydroxy-3-(3-methyl-2-butenyl)phenyl]-7-hydroxy-8-(3-methyl-2-butenyl)- |
3-[2,4-Dihydroxy-3-(3-methyl-2-butenyl)phenyl]-7-hydroxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one |
InChI=1/C25H26O5/c1-14(2)5-8-18-21(26)12-10-17(23(18)28)20-13-16-7-11-22(27)19(9-6-15(3)4)24(16)30-25(20)29/h5-7,10-13,26-28H,8-9H2,1-4H |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.87% | 91.49% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 96.54% | 89.34% |
CHEMBL2581 | P07339 | Cathepsin D | 96.30% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.89% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.43% | 86.33% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 91.23% | 98.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.92% | 96.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.96% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.87% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.52% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.53% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.18% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.43% | 90.71% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.12% | 91.38% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.82% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza glabra |
PubChem | 5324358 |
LOTUS | LTS0071139 |
wikiData | Q105268740 |