Leonoside A
Internal ID | 2fa8bec2-246f-43b1-9307-8eedde6159fe |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2R,3R,4R,5R,6R)-4-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)OC)CO)OCCC4=CC(=C(C=C4)O)O)O)OC5C(C(C(CO5)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/C3=CC(=C(C=C3)O)OC)CO)OCCC4=CC(=C(C=C4)O)O)O)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)O)O |
InChI | InChI=1S/C35H46O19/c1-15-25(42)27(44)32(54-33-28(45)26(43)21(40)14-49-33)35(50-15)53-31-29(46)34(48-10-9-17-3-6-18(37)20(39)11-17)51-23(13-36)30(31)52-24(41)8-5-16-4-7-19(38)22(12-16)47-2/h3-8,11-12,15,21,23,25-40,42-46H,9-10,13-14H2,1-2H3/b8-5+/t15-,21-,23+,25-,26-,27+,28+,29+,30+,31+,32+,33-,34+,35-/m0/s1 |
InChI Key | ZPJGTPAAEPXBQT-KMKHSNLESA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H46O19 |
Molecular Weight | 770.70 g/mol |
Exact Mass | 770.26332923 g/mol |
Topological Polar Surface Area (TPSA) | 293.00 Ų |
XlogP | -1.70 |
140147-66-6 |
[(2R,3R,4R,5R,6R)-4-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
DTXSID401099305 |
beta-(3,4-Dihydroxyphenyl)-ethyl-O-alpha-L-arabinopyranosyl-(1-2)-alpha-L-rhamnopyranosyl-(1-3)-4-O-feruloyl-beta-D-glucopyranoside |
131862-11-8 |
beta-D-Glucopyranoside, 2-(3,4-(dihydroxy)phenyl)ethyl O-alpha-L-arabinopyranosyl-(1-2)-O-6-deoxy-alpha-L-mannopyranosyl-(1-3)-, 4-(3-(4-hydroxy-3-methoxyphenyl)-2-propenoate) |
beta-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-alpha-L-arabinopyranosyl-(1-->2)-O-6-deoxy-alpha-L-mannopyranosyl-(1-->3)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate] |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.87% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.91% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.66% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.25% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.24% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 92.74% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.57% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.22% | 86.92% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.63% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 89.51% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.64% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.36% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.41% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.26% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.56% | 94.45% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.62% | 80.78% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.47% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.92% | 92.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.71% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.60% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.00% | 91.19% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.55% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ajuga salicifolia |
Leonurus glaucescens |
Sideritis trojana |
Stachys byzantina |
Stachys riederi |
PubChem | 6444244 |
LOTUS | LTS0065825 |
wikiData | Q104399824 |