Launobine
| Internal ID | 7992a008-6061-424d-bb1e-d6910a07ba04 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | (12S)-17-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-18-ol |
| SMILES (Canonical) | COC1=C(C2=C(CC3C4=C2C5=C(C=C4CCN3)OCO5)C=C1)O |
| SMILES (Isomeric) | COC1=C(C2=C(C[C@H]3C4=C2C5=C(C=C4CCN3)OCO5)C=C1)O |
| InChI | InChI=1S/C18H17NO4/c1-21-12-3-2-9-6-11-14-10(4-5-19-11)7-13-18(23-8-22-13)16(14)15(9)17(12)20/h2-3,7,11,19-20H,4-6,8H2,1H3/t11-/m0/s1 |
| InChI Key | JIFBCUOVFPCZEW-NSHDSACASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11575802 g/mol |
| Topological Polar Surface Area (TPSA) | 60.00 Ų |
| XlogP | 2.40 |
| 20497-21-6 |
| (+)-Launobine |
| Norbulbocapnine |
| (+)-Launobine; |
| (12S)-17-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-18-ol |
| (S)-11-methoxy-6,7,7a,8-tetrahydro-5H-[1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]benzo[g]quinolin-12-ol |
| CHEMBL516862 |
| DTXSID10942669 |
| CHEBI:174971 |
| AKOS040752437 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.45% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.97% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.23% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.79% | 93.99% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.90% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.18% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.97% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.49% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.27% | 90.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.05% | 88.48% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.04% | 94.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.99% | 96.77% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.16% | 95.78% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.54% | 100.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.07% | 89.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.85% | 98.95% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 84.73% | 95.55% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.71% | 82.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.50% | 99.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.80% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.76% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.19% | 89.50% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.05% | 95.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.74% | 95.56% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.00% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cassytha filiformis |
| Illigera luzonensis |
| Lindera umbellata |
| PubChem | 177134 |
| LOTUS | LTS0061957 |
| wikiData | Q82919674 |