Laserine
Internal ID | 893507f3-1821-475b-b0da-8350db111596 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | [1-(7-methoxy-1,3-benzodioxol-5-yl)-1-[(Z)-2-methylbut-2-enoyl]oxypropan-2-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC(C)C(C1=CC2=C(C(=C1)OC)OCO2)OC(=O)C(=CC)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)OC(C)C(C1=CC2=C(C(=C1)OC)OCO2)OC(=O)/C(=C\C)/C |
InChI | InChI=1S/C21H26O7/c1-7-12(3)20(22)27-14(5)18(28-21(23)13(4)8-2)15-9-16(24-6)19-17(10-15)25-11-26-19/h7-10,14,18H,11H2,1-6H3/b12-7-,13-8- |
InChI Key | YIFLQBNCXIFWEL-AJDRMPRJSA-N |
Popularity | 2 references in papers |
Molecular Formula | C21H26O7 |
Molecular Weight | 390.40 g/mol |
Exact Mass | 390.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 80.30 Ų |
XlogP | 4.10 |
Laserin |
2-epilaserine |
19946-83-9 |
[1-(7-Methoxy-1,3-benzodioxol-5-yl)-1-[(Z)-2-methylbut-2-enoyl]oxypropan-2-yl] (Z)-2-methylbut-2-enoate |
AKOS040735416 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.42% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.52% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.28% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.16% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.98% | 99.17% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.81% | 89.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.58% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.00% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.41% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 84.31% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 83.98% | 98.75% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.61% | 94.80% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.36% | 94.73% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.15% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Athamanta vayredana |
Ferula arrigonii |
Ferula communis |
Ferula communis subsp. linkii |
Ferula latipinna |
Ferula tingitana |
PubChem | 102571636 |
LOTUS | LTS0133864 |
wikiData | Q104398740 |