l-[-]-4-Hydroxy-1-methylproline
| Internal ID | f0b86a4f-515c-4223-ae4b-37001128b0ba |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Proline and derivatives |
| IUPAC Name | 4-hydroxy-1-methylpyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CN1CC(CC1C(=O)O)O |
| SMILES (Isomeric) | CN1CC(CC1C(=O)O)O |
| InChI | InChI=1S/C6H11NO3/c1-7-3-4(8)2-5(7)6(9)10/h4-5,8H,2-3H2,1H3,(H,9,10) |
| InChI Key | FMIPNAUMSPFTHK-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | -2.90 |
| NSC40250 |
| MEGxp0_001961 |
| SCHEMBL1303907 |
| l-[-]-4-Hydroxy-1-methylproline |
| NSC-40250 |
| AKOS000280645 |
| AKOS022634183 |
| SY279078 |
| FT-0698801 |
| 4-hydroxy-1-methyl pyrrolidine-2-carboxylic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of l-[-]-4-Hydroxy-1-methylproline](https://plantaedb.com/storage/docs/compounds/2023/11/l-4-hydroxy-1-methylproline.jpg "2D Structure of l-[-]-4-Hydroxy-1-methylproline")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.18% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.03% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.17% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.78% | 91.19% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.62% | 93.00% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.42% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acritopappus longifolius |
| Capsicum annuum |
| Copaifera multijuga |
| Croton megalobotrys |
| Ipomoea carnea |
| Melaleuca lanceolata |
| Toddalia asiatica |
| Trichilia claussenii |
| PubChem | 237040 |
| LOTUS | LTS0081988 |
| wikiData | Q104166527 |