Kojic acid
Internal ID | d7db4301-93a5-4077-a1cd-d1f089de4d52 |
Taxonomy | Organoheterocyclic compounds > Pyrans > Pyranones and derivatives |
IUPAC Name | 5-hydroxy-2-(hydroxymethyl)pyran-4-one |
SMILES (Canonical) | C1=C(OC=C(C1=O)O)CO |
SMILES (Isomeric) | C1=C(OC=C(C1=O)O)CO |
InChI | InChI=1S/C6H6O4/c7-2-4-1-5(8)6(9)3-10-4/h1,3,7,9H,2H2 |
InChI Key | BEJNERDRQOWKJM-UHFFFAOYSA-N |
Popularity | 2,172 references in papers |
Molecular Formula | C6H6O4 |
Molecular Weight | 142.11 g/mol |
Exact Mass | 142.02660867 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | -0.90 |
Atomic LogP (AlogP) | -0.16 |
H-Bond Acceptor | 4 |
H-Bond Donor | 2 |
Rotatable Bonds | 1 |
501-30-4 |
5-Hydroxy-2-(hydroxymethyl)-4H-pyran-4-one |
5-Hydroxy-2-(hydroxymethyl)-4-pyrone |
5-hydroxy-2-(hydroxymethyl)pyran-4-one |
4H-PYRAN-4-ONE, 5-HYDROXY-2-(HYDROXYMETHYL)- |
5-Hydroxy-2-hydroxymethyl-4-pyrone |
acido kojico |
2-Hydroxymethyl-5-hydroxy-gamma-pyrone |
Kojisaeure |
CCRIS 4131 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9139 | 91.39% |
Caco-2 | + | 0.5133 | 51.33% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | + | 0.5143 | 51.43% |
Subcellular localzation | Mitochondria | 0.8131 | 81.31% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8971 | 89.71% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.7200 | 72.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | - | 0.9784 | 97.84% |
P-glycoprotein inhibitior | - | 0.9790 | 97.90% |
P-glycoprotein substrate | - | 0.9904 | 99.04% |
CYP3A4 substrate | - | 0.7325 | 73.25% |
CYP2C9 substrate | - | 0.8000 | 80.00% |
CYP2D6 substrate | - | 0.8470 | 84.70% |
CYP3A4 inhibition | - | 0.9090 | 90.90% |
CYP2C9 inhibition | - | 0.9070 | 90.70% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9557 | 95.57% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | - | 0.9807 | 98.07% |
CYP inhibitory promiscuity | - | 0.7747 | 77.47% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9000 | 90.00% |
Carcinogenicity (trinary) | Non-required | 0.7174 | 71.74% |
Eye corrosion | - | 0.9352 | 93.52% |
Eye irritation | + | 0.9604 | 96.04% |
Skin irritation | - | 0.5544 | 55.44% |
Skin corrosion | - | 0.9403 | 94.03% |
Ames mutagenesis | + | 0.7700 | 77.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8767 | 87.67% |
Micronuclear | - | 0.5401 | 54.01% |
Hepatotoxicity | - | 0.5125 | 51.25% |
skin sensitisation | + | 0.5367 | 53.67% |
Respiratory toxicity | + | 0.5889 | 58.89% |
Reproductive toxicity | + | 0.5222 | 52.22% |
Mitochondrial toxicity | - | 0.7250 | 72.50% |
Nephrotoxicity | - | 0.6371 | 63.71% |
Acute Oral Toxicity (c) | III | 0.6190 | 61.90% |
Estrogen receptor binding | - | 0.8682 | 86.82% |
Androgen receptor binding | - | 0.5381 | 53.81% |
Thyroid receptor binding | - | 0.8145 | 81.45% |
Glucocorticoid receptor binding | - | 0.7419 | 74.19% |
Aromatase binding | - | 0.7046 | 70.46% |
PPAR gamma | - | 0.6419 | 64.19% |
Honey bee toxicity | - | 0.9596 | 95.96% |
Biodegradation | + | 0.7000 | 70.00% |
Crustacea aquatic toxicity | - | 0.7400 | 74.00% |
Fish aquatic toxicity | - | 0.7578 | 75.78% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5485 | P14920 | D-amino-acid oxidase |
2000 nM |
IC50 |
PMID: 23683589
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL1973 | P14679 | Tyrosinase |
22940 nM 125000 nM 9150 nM 7400 nM 66550 nM 133400 nM 16670 nM 22940 nM 125000 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
DOI: 10.1016/0960-894X(96)00221-1
PMID: 12880321 PMID: 26386819 PMID: 21334791 PMID: 19359068 PMID: 16919455 PMID: 16275084 PMID: 15125944 PMID: 14510598 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.70% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.63% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.08% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.34% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 83.45% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.42% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.80% | 89.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.49% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chaenomeles sinensis |
Glycine max |
Marrubium cylleneum |
PubChem | 3840 |
NPASS | NPC116366 |
ChEMBL | CHEMBL287556 |
LOTUS | LTS0125477 |
wikiData | Q416285 |