Karpoxanthin
Internal ID | f8bb1298-b917-4e86-905a-ee22e318c8dd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Tetraterpenoids > Carotenoids > Xanthophylls |
IUPAC Name | (1R,2R,4S)-1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethylcyclohexane-1,2,4-triol |
SMILES (Canonical) | CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2(C(CC(CC2(C)O)O)(C)C)O)C)C |
SMILES (Isomeric) | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@@]2([C@](C[C@H](CC2(C)C)O)(C)O)O)/C)/C |
InChI | InChI=1S/C40H58O4/c1-29(17-13-19-31(3)21-22-36-33(5)25-34(41)26-37(36,6)7)15-11-12-16-30(2)18-14-20-32(4)23-24-40(44)38(8,9)27-35(42)28-39(40,10)43/h11-24,34-35,41-44H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,22-21+,24-23+,29-15+,30-16+,31-19+,32-20+/t34-,35+,39-,40-/m1/s1 |
InChI Key | DJOWTWWHMWQATC-SZYTUFQFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H58O4 |
Molecular Weight | 602.90 g/mol |
Exact Mass | 602.43351033 g/mol |
Topological Polar Surface Area (TPSA) | 80.90 Ų |
XlogP | 9.30 |
CHEBI:176198 |
DTXSID801228879 |
99664-48-9 |
(3S,3'R,5R,6R)-beta,beta-Carotene-3,3',5,6(5H,6H)-tetrol |
(1R,2R,4S)-1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethylcyclohexane-1,2,4-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.91% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.17% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.00% | 91.11% |
CHEMBL1870 | P28702 | Retinoid X receptor beta | 87.28% | 95.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.70% | 91.71% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 86.43% | 92.97% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.23% | 95.56% |
CHEMBL2004 | P48443 | Retinoid X receptor gamma | 85.69% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.23% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.93% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.74% | 90.17% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 84.17% | 95.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.99% | 100.00% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 82.97% | 91.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.79% | 95.89% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.68% | 90.24% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.14% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Lilium lancifolium |
PubChem | 23258401 |
LOTUS | LTS0246217 |
wikiData | Q104982617 |