Kanzonol K
Internal ID | 378eb2c3-a4c0-4885-90fb-d457f908cdae |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
IUPAC Name | 3-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-5-hydroxy-7-methoxy-6-(3-methylbut-2-enyl)chromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC(=C1O)C2=COC3=CC(=C(C(=C3C2=O)O)CC=C(C)C)OC)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC(=C1O)C2=COC3=CC(=C(C(=C3C2=O)O)CC=C(C)C)OC)O)C |
InChI | InChI=1S/C26H28O6/c1-14(2)6-8-17-20(27)11-10-16(24(17)28)19-13-32-22-12-21(31-5)18(9-7-15(3)4)25(29)23(22)26(19)30/h6-7,10-13,27-29H,8-9H2,1-5H3 |
InChI Key | UWUOGPWSIVRQNM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O6 |
Molecular Weight | 436.50 g/mol |
Exact Mass | 436.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 6.50 |
CHEBI:175519 |
DTXSID901318449 |
2',4',5-Trihydroxy-7-methoxy-3',6-diprenylisoflavone |
156281-30-0 |
3-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-5-hydroxy-7-methoxy-6-(3-methylbut-2-enyl)chromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.64% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.94% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.65% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.98% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.11% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.04% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.67% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.64% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.88% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.04% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.44% | 91.49% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 81.51% | 98.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.36% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.30% | 99.15% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.57% | 98.11% |
CHEMBL2535 | P11166 | Glucose transporter | 80.17% | 98.75% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.09% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza uralensis |
Taxus cuspidata |
PubChem | 131753069 |
LOTUS | LTS0121478 |
wikiData | Q104995056 |