Kaempferol 3-sophoroside 7-glucoside
Internal ID | 3553c3c6-6341-409e-8bc4-eeb174e24c97 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)O |
InChI | InChI=1S/C33H40O21/c34-7-15-19(39)23(43)26(46)31(50-15)48-12-5-13(38)18-14(6-12)49-28(10-1-3-11(37)4-2-10)29(22(18)42)53-33-30(25(45)21(41)17(9-36)52-33)54-32-27(47)24(44)20(40)16(8-35)51-32/h1-6,15-17,19-21,23-27,30-41,43-47H,7-9H2 |
InChI Key | MBFNAZBJKVFNKZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O21 |
Molecular Weight | 772.70 g/mol |
Exact Mass | 772.20620828 g/mol |
Topological Polar Surface Area (TPSA) | 345.00 Ų |
XlogP | -2.70 |
CHEBI:191788 |
FT-0775733 |
B0005-053547 |
3-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.34% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.82% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.58% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.05% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.00% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.17% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.76% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.15% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.94% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.76% | 86.92% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.14% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.92% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.06% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.69% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 85.19% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.73% | 85.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.09% | 96.21% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 83.84% | 98.35% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.90% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.70% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.50% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brassica napus |
Crocus sativus |
Equisetum ramosissimum subsp. debile |
Hosta ventricosa |
Trigonella foenum-graecum |
PubChem | 12960459 |
LOTUS | LTS0065209 |
wikiData | Q105160711 |