Kaempferol 3-apiosyl-(1->2)-glucoside-4'-glucoside
Internal ID | dbf506f0-e110-424f-85d7-bdcd1974a6c4 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,7-dihydroxy-2-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1C(C(C(O1)OC2C(C(C(OC2OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)CO)O)O)O)(CO)O |
SMILES (Isomeric) | C1C(C(C(O1)OC2C(C(C(OC2OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)CO)O)O)O)(CO)O |
InChI | InChI=1S/C32H38O20/c33-7-16-19(38)22(41)24(43)29(49-16)47-13-3-1-11(2-4-13)25-26(21(40)18-14(37)5-12(36)6-15(18)48-25)51-30-27(23(42)20(39)17(8-34)50-30)52-31-28(44)32(45,9-35)10-46-31/h1-6,16-17,19-20,22-24,27-31,33-39,41-45H,7-10H2 |
InChI Key | UELKBPQWENTRMS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H38O20 |
Molecular Weight | 742.60 g/mol |
Exact Mass | 742.19564360 g/mol |
Topological Polar Surface Area (TPSA) | 324.00 Ų |
XlogP | -2.30 |
LMPK12111770 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.75% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.96% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.69% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.07% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.02% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.32% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.84% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.92% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.56% | 83.57% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.69% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.71% | 94.75% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.34% | 94.45% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.93% | 95.83% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.82% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.39% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.30% | 95.89% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 84.92% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.76% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.10% | 94.73% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.05% | 95.71% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 83.60% | 80.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.40% | 92.94% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.22% | 94.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.90% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.67% | 95.78% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.14% | 95.53% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.98% | 97.36% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.29% | 91.49% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.00% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.00% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllolobium chinense |
PubChem | 44258842 |
LOTUS | LTS0234583 |
wikiData | Q105270985 |