KadcoccinicacidC
Internal ID | 3116c170-326c-45d6-82fd-222a912ebbe2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (Z,6R)-2-methyl-6-[(2S,8R,11S,12S,15R,17S)-2,7,7,12-tetramethyl-16-methylidene-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,17]octadec-1(18)-en-15-yl]hept-2-enoic acid |
SMILES (Canonical) | CC(CCC=C(C)C(=O)O)C1CCC2(C3CCC4C(OC(=O)CCC4(C3=CC2C1=C)C)(C)C)C |
SMILES (Isomeric) | C[C@H](CC/C=C(/C)\C(=O)O)[C@H]1CC[C@]2([C@@H]3CC[C@@H]4[C@@](C3=C[C@H]2C1=C)(CCC(=O)OC4(C)C)C)C |
InChI | InChI=1S/C30H44O4/c1-18(9-8-10-19(2)27(32)33)21-13-15-29(6)22-11-12-25-28(4,5)34-26(31)14-16-30(25,7)24(22)17-23(29)20(21)3/h10,17-18,21-23,25H,3,8-9,11-16H2,1-2,4-7H3,(H,32,33)/b19-10-/t18-,21-,22-,23+,25+,29+,30-/m1/s1 |
InChI Key | ZMWGNOQGBYBGGS-HGIOFNIASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H44O4 |
Molecular Weight | 468.70 g/mol |
Exact Mass | 468.32395988 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 6.60 |
KadcoccinicacidC |
Kadcoccinic acid C |
CHEMBL3593372 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.76% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.62% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.82% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.03% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.30% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.57% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.72% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.10% | 96.38% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.02% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.28% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.03% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.97% | 90.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.75% | 94.75% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.83% | 89.05% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.59% | 90.08% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 81.92% | 92.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.86% | 95.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.56% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.02% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura coccinea |
PubChem | 122181858 |
LOTUS | LTS0159207 |
wikiData | Q105379759 |