Ivermectin B1a
Internal ID | a079a3c2-fa90-437b-ba0f-c43775a13659 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues > Milbemycins |
IUPAC Name | (1R,4S,5'S,6R,6'R,8R,10E,12S,13S,14E,16E,20R,21R,24S)-6'-[(2S)-butan-2-yl]-21,24-dihydroxy-12-[(2R,4S,5S,6S)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
SMILES (Canonical) | CCC(C)C1C(CCC2(O1)CC3CC(O2)CC=C(C(C(C=CC=C4COC5C4(C(C=C(C5O)C)C(=O)O3)O)C)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)O)OC)OC)C)C |
SMILES (Isomeric) | CC[C@H](C)[C@@H]1[C@H](CC[C@@]2(O1)C[C@@H]3C[C@H](O2)C/C=C(/[C@H]([C@H](/C=C/C=C/4\CO[C@H]5[C@@]4([C@@H](C=C([C@H]5O)C)C(=O)O3)O)C)O[C@H]6C[C@@H]([C@H]([C@@H](O6)C)O[C@H]7C[C@@H]([C@H]([C@@H](O7)C)O)OC)OC)\C)C |
InChI | InChI=1S/C48H74O14/c1-11-25(2)43-28(5)17-18-47(62-43)23-34-20-33(61-47)16-15-27(4)42(26(3)13-12-14-32-24-55-45-40(49)29(6)19-35(46(51)58-34)48(32,45)52)59-39-22-37(54-10)44(31(8)57-39)60-38-21-36(53-9)41(50)30(7)56-38/h12-15,19,25-26,28,30-31,33-45,49-50,52H,11,16-18,20-24H2,1-10H3/b13-12+,27-15+,32-14+/t25-,26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40+,41-,42-,43+,44-,45+,47+,48+/m0/s1 |
InChI Key | AZSNMRSAGSSBNP-XPNPUAGNSA-N |
Popularity | 11,985 references in papers |
Molecular Formula | C48H74O14 |
Molecular Weight | 875.10 g/mol |
Exact Mass | 874.50785703 g/mol |
Topological Polar Surface Area (TPSA) | 170.00 Ų |
XlogP | 4.10 |
Atomic LogP (AlogP) | 5.60 |
H-Bond Acceptor | 14 |
H-Bond Donor | 3 |
Rotatable Bonds | 8 |
IVERMECTIN |
Dihydroavermectin B1a |
70288-86-7 |
22,23-Dihydroavermectin B1a |
70161-11-4 |
71827-03-7 |
Ivermectin Component B1a |
avermectin H2B1a |
C48H74O14 |
MK-933 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9676 | 96.76% |
Caco-2 | - | 0.8729 | 87.29% |
Blood Brain Barrier | - | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.8053 | 80.53% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8624 | 86.24% |
OATP1B3 inhibitior | + | 0.9333 | 93.33% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8250 | 82.50% |
BSEP inhibitior | + | 0.9629 | 96.29% |
P-glycoprotein inhibitior | + | 0.7776 | 77.76% |
P-glycoprotein substrate | + | 0.9343 | 93.43% |
CYP3A4 substrate | + | 0.7463 | 74.63% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8929 | 89.29% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9045 | 90.45% |
CYP2C8 inhibition | + | 0.7452 | 74.52% |
CYP inhibitory promiscuity | - | 0.6859 | 68.59% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5219 | 52.19% |
Eye corrosion | - | 0.9900 | 99.00% |
Eye irritation | - | 0.9112 | 91.12% |
Skin irritation | + | 0.5259 | 52.59% |
Skin corrosion | - | 0.9409 | 94.09% |
Ames mutagenesis | - | 0.6970 | 69.70% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7425 | 74.25% |
Micronuclear | - | 0.8300 | 83.00% |
Hepatotoxicity | + | 0.8250 | 82.50% |
skin sensitisation | - | 0.9118 | 91.18% |
Respiratory toxicity | + | 0.7333 | 73.33% |
Reproductive toxicity | + | 0.9556 | 95.56% |
Mitochondrial toxicity | + | 0.6375 | 63.75% |
Nephrotoxicity | - | 0.8315 | 83.15% |
Acute Oral Toxicity (c) | III | 0.4494 | 44.94% |
Estrogen receptor binding | + | 0.8906 | 89.06% |
Androgen receptor binding | + | 0.8349 | 83.49% |
Thyroid receptor binding | + | 0.5258 | 52.58% |
Glucocorticoid receptor binding | + | 0.7657 | 76.57% |
Aromatase binding | + | 0.6227 | 62.27% |
PPAR gamma | + | 0.7844 | 78.44% |
Honey bee toxicity | + | 0.8989 | 89.89% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | + | 0.5500 | 55.00% |
Fish aquatic toxicity | + | 0.9747 | 97.47% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293235 | P02545 | Prelamin-A/C |
398.1 nM |
Potency |
via Super-PRED
|
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
3.3 nM |
Potency |
via Super-PRED
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
31.6 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.11% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.63% | 97.25% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.72% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.12% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.63% | 96.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.44% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.12% | 95.93% |
CHEMBL1871 | P10275 | Androgen Receptor | 92.06% | 96.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.58% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.74% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.07% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.37% | 94.45% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.90% | 96.47% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.49% | 96.38% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.86% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.59% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.56% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.23% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.13% | 99.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.08% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.29% | 95.89% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.44% | 98.46% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.09% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.95% | 90.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 81.10% | 98.59% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.82% | 97.33% |
CHEMBL2581 | P07339 | Cathepsin D | 80.78% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum nigrum |
Veronicastrum sibiricum |
PubChem | 6321424 |
NPASS | NPC183353 |
LOTUS | LTS0233194 |
wikiData | Q27132923 |