Isoswertisin
Internal ID | 909e7cf2-4887-4b80-8573-39280de015cd |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-8-[(2S,4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=CC=C(C=C3)O)C4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=CC=C(C=C3)O)[C@H]4C([C@H]([C@H](C(O4)CO)O)O)O |
InChI | InChI=1S/C22H22O10/c1-30-14-7-12(26)16-11(25)6-13(9-2-4-10(24)5-3-9)31-21(16)17(14)22-20(29)19(28)18(27)15(8-23)32-22/h2-7,15,18-20,22-24,26-29H,8H2,1H3/t15?,18-,19-,20?,22-/m0/s1 |
InChI Key | HHPLIFSIFJSIBY-UHJXJGFFSA-N |
Popularity | 8 references in papers |
Molecular Formula | C22H22O10 |
Molecular Weight | 446.40 g/mol |
Exact Mass | 446.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.50 |
7-O-Methylvitexin |
LMPK12110973 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.29% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.02% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.42% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.63% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.38% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.85% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.43% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.82% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.44% | 99.15% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.92% | 96.21% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.68% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.49% | 94.73% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.99% | 97.14% |
CHEMBL3194 | P02766 | Transthyretin | 83.99% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.90% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.86% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.54% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.52% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 44258317 |
LOTUS | LTS0023982 |
wikiData | Q104395734 |