Isonuezhenide
Internal ID | c7ac6643-e803-4d7e-bb67-0c5293ea4fb8 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | methyl 4-[2-[4,5-dihydroxy-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxan-3-yl]oxy-2-oxoethyl]-5-ethylidene-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OC3C(OC(C(C3O)O)OCCC4=CC=C(C=C4)O)CO |
SMILES (Isomeric) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OC3C(OC(C(C3O)O)OCCC4=CC=C(C=C4)O)CO |
InChI | InChI=1S/C31H42O17/c1-3-16-17(18(28(41)42-2)13-44-29(16)48-31-25(39)23(37)22(36)19(11-32)45-31)10-21(35)47-27-20(12-33)46-30(26(40)24(27)38)43-9-8-14-4-6-15(34)7-5-14/h3-7,13,17,19-20,22-27,29-34,36-40H,8-12H2,1-2H3 |
InChI Key | BXFDSXRULGPMLO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H42O17 |
Molecular Weight | 686.70 g/mol |
Exact Mass | 686.24219987 g/mol |
Topological Polar Surface Area (TPSA) | 261.00 Ų |
XlogP | -2.20 |
DTXSID401317577 |
112693-22-8 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.36% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.55% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.80% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.78% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.61% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.41% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.23% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.02% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.23% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.29% | 94.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.24% | 94.62% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.06% | 95.64% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.76% | 94.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.54% | 94.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.65% | 97.79% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.58% | 85.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.18% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.01% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligustrum lucidum |
PubChem | 162912854 |
LOTUS | LTS0132710 |
wikiData | Q104947910 |