Isomesuol
Internal ID | 13de06ed-cec9-4fe6-9bd8-730c754c8f5d |
Taxonomy | Phenylpropanoids and polyketides > Neoflavonoids > Prenylated neoflavonoids |
IUPAC Name | 5,7-dihydroxy-6-(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-4-phenylchromen-2-one |
SMILES (Canonical) | CC(C)C(=O)C1=C(C(=C(C2=C1OC(=O)C=C2C3=CC=CC=C3)O)CC=C(C)C)O |
SMILES (Isomeric) | CC(C)C(=O)C1=C(C(=C(C2=C1OC(=O)C=C2C3=CC=CC=C3)O)CC=C(C)C)O |
InChI | InChI=1S/C24H24O5/c1-13(2)10-11-16-22(27)19-17(15-8-6-5-7-9-15)12-18(25)29-24(19)20(23(16)28)21(26)14(3)4/h5-10,12,14,27-28H,11H2,1-4H3 |
InChI Key | HFESPLMGUIFVMR-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C24H24O5 |
Molecular Weight | 392.40 g/mol |
Exact Mass | 392.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 5.60 |
CHEMBL383592 |
SCHEMBL16367909 |
BDBM50172750 |
5,7-dihydroxy-6-(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-4-phenyl-chromen-2-one |
5,7-Dihydroxy-8-isobutyryl-6-(3-methyl-but-2-enyl)-4-phenyl-chromen-2-one |
2H-1-Benzopyran-2-one, 5,7-dihydroxy-6-(3-methyl-2-butenyl)-8-(2-methyl-1-oxopropyl)-4-phenyl- |
5,7-dihydroxy-6-(3-methyl-2-butenyl)-8-(2-methyl-1-oxopropyl)-4-phenyl-2 h -1-benzopyran-2-one |
![2D Structure of Isomesuol 2D Structure of Isomesuol](https://plantaedb.com/storage/docs/compounds/2023/11/isomesuol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.37% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.19% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.15% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.44% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.67% | 95.50% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.32% | 89.34% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.78% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.27% | 96.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.57% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.01% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.66% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.64% | 99.15% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.42% | 97.21% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.32% | 91.71% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.19% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.12% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia tithymaloides |
PubChem | 5277587 |
LOTUS | LTS0230240 |
wikiData | Q105027259 |