Irenolone
Internal ID | 20e4c78b-9b0a-48e0-a9a5-613b316fb57d |
Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
IUPAC Name | 2-hydroxy-4-(4-hydroxyphenyl)phenalen-1-one |
SMILES (Canonical) | C1=CC2=C3C(=C1)C(=O)C(=CC3=C(C=C2)C4=CC=C(C=C4)O)O |
SMILES (Isomeric) | C1=CC2=C3C(=C1)C(=O)C(=CC3=C(C=C2)C4=CC=C(C=C4)O)O |
InChI | InChI=1S/C19H12O3/c20-13-7-4-11(5-8-13)14-9-6-12-2-1-3-15-18(12)16(14)10-17(21)19(15)22/h1-10,20-21H |
InChI Key | UQMKPTIDKHEGFW-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C19H12O3 |
Molecular Weight | 288.30 g/mol |
Exact Mass | 288.078644241 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 4.30 |
149184-19-0 |
2-hydroxy-4-(4-hydroxyphenyl)phenalen-1-one |
CHEMBL1164175 |
CHEBI:189809 |
AKOS004902211 |
2-hydroxy-4-(4-hydroxyphenyl)-1H-phenalen-1-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.52% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.25% | 91.49% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 93.15% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.62% | 95.56% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 92.31% | 98.35% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.03% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.94% | 86.33% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.40% | 91.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.07% | 94.75% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.90% | 96.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.52% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.89% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 84.09% | 98.75% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.09% | 93.10% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.96% | 82.69% |
CHEMBL1944 | P08473 | Neprilysin | 82.22% | 92.63% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.00% | 99.15% |
CHEMBL1907 | P15144 | Aminopeptidase N | 81.30% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Musa × paradisiaca |
Musa acuminata |
Musa balbisiana |
PubChem | 2754650 |
LOTUS | LTS0121517 |
wikiData | Q104402330 |