Ibotalactone B
Internal ID | 6923e4d9-b3f7-4fb8-a5e9-33b35f058bb2 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | (1R,4aS,8S,8aS)-8-[(2S,3R,4S,5S,6R)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-methyl-3-oxo-4,4a,8,8a-tetrahydro-1H-pyrano[3,4-c]pyran-5-carboxylic acid |
SMILES (Canonical) | CC1C2C(CC(=O)O1)C(=COC2OC3C(C(C(C(O3)COC(=O)C=CC4=CC(=C(C=C4)O)O)O)O)O)C(=O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]2[C@H](CC(=O)O1)C(=CO[C@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)/C=C/C4=CC(=C(C=C4)O)O)O)O)O)C(=O)O |
InChI | InChI=1S/C25H28O14/c1-10-19-12(7-18(29)37-10)13(23(33)34)8-36-24(19)39-25-22(32)21(31)20(30)16(38-25)9-35-17(28)5-3-11-2-4-14(26)15(27)6-11/h2-6,8,10,12,16,19-22,24-27,30-32H,7,9H2,1H3,(H,33,34)/b5-3+/t10-,12-,16-,19-,20-,21+,22-,24+,25+/m1/s1 |
InChI Key | LNUWWJOQXXRYFK-WTRMFIOSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O14 |
Molecular Weight | 552.50 g/mol |
Exact Mass | 552.14790556 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | -0.60 |
Ibotalactone B |
(1R,4aS,8S,8aS)-8-[(2S,3R,4S,5S,6R)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-methyl-3-oxo-4,4a,8,8a-tetrahydro-1H-pyrano[3,4-c]pyran-5-carboxylic acid |
![2D Structure of Ibotalactone B 2D Structure of Ibotalactone B](https://plantaedb.com/storage/docs/compounds/2023/11/ibotalactone-b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.72% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.62% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.86% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.47% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.49% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.26% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 90.03% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.81% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.28% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.89% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.12% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.39% | 90.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.26% | 92.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.10% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.99% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.02% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligustrum obtusifolium |
PubChem | 6442829 |
LOTUS | LTS0084886 |
wikiData | Q105154513 |