Hydroxyprogesterone
Internal ID | b51f1946-194a-4a2a-b9bb-53aac4cb2d42 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Pregnane steroids > Gluco/mineralocorticoids, progestogins and derivatives |
IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CC(=O)C1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O |
SMILES (Isomeric) | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O |
InChI | InChI=1S/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
InChI Key | DBPWSSGDRRHUNT-CEGNMAFCSA-N |
Popularity | 4,338 references in papers |
Molecular Formula | C21H30O3 |
Molecular Weight | 330.50 g/mol |
Exact Mass | 330.21949481 g/mol |
Topological Polar Surface Area (TPSA) | 54.40 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.84 |
H-Bond Acceptor | 3 |
H-Bond Donor | 1 |
Rotatable Bonds | 1 |
17ALPHA-HYDROXYPROGESTERONE |
68-96-2 |
17-Hydroxyprogesterone |
17a-Hydroxyprogesterone |
Prodix |
Prodox |
Gestageno gador |
Pregn-4-ene-3,20-dione, 17-hydroxy- |
Setaderm |
Oxiprogesteronum |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.8857 | 88.57% |
Blood Brain Barrier | + | 0.8750 | 87.50% |
Human oral bioavailability | - | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.8483 | 84.83% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9727 | 97.27% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | + | 0.9500 | 95.00% |
BSEP inhibitior | + | 0.9333 | 93.33% |
P-glycoprotein inhibitior | + | 0.8915 | 89.15% |
P-glycoprotein substrate | - | 0.6806 | 68.06% |
CYP3A4 substrate | + | 0.7519 | 75.19% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8953 | 89.53% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.6103 | 61.03% |
CYP2D6 inhibition | - | 0.9506 | 95.06% |
CYP1A2 inhibition | - | 0.9425 | 94.25% |
CYP2C8 inhibition | + | 0.5463 | 54.63% |
CYP inhibitory promiscuity | - | 0.9304 | 93.04% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5040 | 50.40% |
Eye corrosion | - | 0.9945 | 99.45% |
Eye irritation | - | 0.9808 | 98.08% |
Skin irritation | + | 0.7349 | 73.49% |
Skin corrosion | - | 0.9429 | 94.29% |
Ames mutagenesis | - | 0.8679 | 86.79% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3827 | 38.27% |
Micronuclear | - | 0.8500 | 85.00% |
Hepatotoxicity | + | 0.8500 | 85.00% |
skin sensitisation | - | 0.7124 | 71.24% |
Respiratory toxicity | + | 0.9778 | 97.78% |
Reproductive toxicity | + | 1.0000 | 100.00% |
Mitochondrial toxicity | + | 1.0000 | 100.00% |
Nephrotoxicity | - | 0.8449 | 84.49% |
Acute Oral Toxicity (c) | IV | 0.5200 | 52.00% |
Estrogen receptor binding | + | 0.9007 | 90.07% |
Androgen receptor binding | + | 0.9139 | 91.39% |
Thyroid receptor binding | + | 0.8355 | 83.55% |
Glucocorticoid receptor binding | + | 0.9100 | 91.00% |
Aromatase binding | + | 0.8021 | 80.21% |
PPAR gamma | - | 0.6799 | 67.99% |
Honey bee toxicity | - | 0.8102 | 81.02% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
Fish aquatic toxicity | + | 0.9900 | 99.00% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
4730 nM |
IC50 |
via CMAUP
|
CHEMBL1293237 | P54132 | Bloom syndrome protein |
5011.9 nM 5011.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL2421 | P08185 | Corticosteroid binding globulin |
18.2 nM |
Ki |
PMID: 15139751
|
CHEMBL238 | Q01959 | Dopamine transporter |
6905 nM |
IC50 |
via CMAUP
|
CHEMBL2034 | P04150 | Glucocorticoid receptor |
51 nM |
IC50 |
via CMAUP
|
CHEMBL3385 | P27361 | MAP kinase ERK1 |
3157 nM |
IC50 |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
12589.3 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
25118.9 nM 5623.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
2238.7 nM |
Potency |
via CMAUP
|
CHEMBL3305 | P04278 | Testis-specific androgen-binding protein |
100 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 96.74% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.59% | 91.11% |
CHEMBL1871 | P10275 | Androgen Receptor | 93.17% | 96.43% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.22% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.98% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.30% | 91.19% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.19% | 94.78% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.98% | 97.25% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.26% | 85.30% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.44% | 82.69% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.41% | 93.04% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.36% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.23% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Linum usitatissimum |
Vitex agnus-castus |
PubChem | 6238 |
NPASS | NPC144258 |
ChEMBL | CHEMBL1062 |
LOTUS | LTS0226374 |
wikiData | Q175901 |