Hydroxycaffeic acid
| Internal ID | 7de5a55d-ec2d-43aa-9b33-780ae560cbfe |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenylpyruvic acid derivatives |
| IUPAC Name | (Z)-3-(3,4-dihydroxyphenyl)-2-hydroxyprop-2-enoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1C=C(C(=O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1/C=C(/C(=O)O)\O)O)O |
| InChI | InChI=1S/C9H8O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-4,10-12H,(H,13,14)/b8-4- |
| InChI Key | LEVWXDHUVBDUSV-YWEYNIOJSA-N |
| Popularity | 21 references in papers |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.03717335 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 1.00 |
| SCHEMBL22543058 |
| DTXSID901341777 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.89% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.27% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.09% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 90.61% | 90.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.11% | 99.15% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.68% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.63% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.96% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.72% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Borago officinalis |
| Olea europaea |
| PubChem | 11063337 |
| LOTUS | LTS0267014 |
| wikiData | Q104376024 |