Hydramicromelin B
Internal ID | f6b1300f-cb79-4f19-a42f-47943616a484 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 6-[(2R,3R,4S)-3,4-dihydroxy-4-methyl-5-oxooxolan-2-yl]-7-methoxychromen-2-one |
SMILES (Canonical) | CC1(C(C(OC1=O)C2=C(C=C3C(=C2)C=CC(=O)O3)OC)O)O |
SMILES (Isomeric) | C[C@@]1([C@@H]([C@H](OC1=O)C2=C(C=C3C(=C2)C=CC(=O)O3)OC)O)O |
InChI | InChI=1S/C15H14O7/c1-15(19)13(17)12(22-14(15)18)8-5-7-3-4-11(16)21-9(7)6-10(8)20-2/h3-6,12-13,17,19H,1-2H3/t12-,13-,15+/m1/s1 |
InChI Key | XSUHWPFITUMCFA-NFAWXSAZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H14O7 |
Molecular Weight | 306.27 g/mol |
Exact Mass | 306.07395278 g/mol |
Topological Polar Surface Area (TPSA) | 102.00 Ų |
XlogP | 0.30 |
6-[(2R,3R,4S)-3,4-dihydroxy-4-methyl-5-oxooxolan-2-yl]-7-methoxychromen-2-one |
369391-55-9 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.04% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.98% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.95% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.86% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.79% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.82% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.74% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 87.20% | 98.95% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.49% | 94.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.09% | 97.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.00% | 97.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.30% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Micromelum integerrimum |
PubChem | 21575176 |
LOTUS | LTS0074181 |
wikiData | Q105341259 |