Hortiacine
Internal ID | 3a6d9c0e-3ea7-4143-a3ac-841a1b699d35 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
IUPAC Name | 7-methoxy-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one |
SMILES (Canonical) | COC1=CC2=C(C=C1)NC3=C2CCN4C3=NC5=CC=CC=C5C4=O |
SMILES (Isomeric) | COC1=CC2=C(C=C1)NC3=C2CCN4C3=NC5=CC=CC=C5C4=O |
InChI | InChI=1S/C19H15N3O2/c1-24-11-6-7-16-14(10-11)12-8-9-22-18(17(12)20-16)21-15-5-3-2-4-13(15)19(22)23/h2-7,10,20H,8-9H2,1H3 |
InChI Key | JNHSRGXMKPJTEV-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H15N3O2 |
Molecular Weight | 317.30 g/mol |
Exact Mass | 317.116426730 g/mol |
Topological Polar Surface Area (TPSA) | 57.70 Ų |
XlogP | 3.00 |
Atomic LogP (AlogP) | 3.11 |
H-Bond Acceptor | 4 |
H-Bond Donor | 1 |
Rotatable Bonds | 1 |
10-Methoxylrutaecarpine |
CHEMBL85826 |
MLS000076384 |
SMR000013006 |
SR-01000366081 |
NSC660030 |
Opera_ID_833 |
Oprea1_495321 |
cid_378227 |
HMS1691I06 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9972 | 99.72% |
Caco-2 | + | 0.8677 | 86.77% |
Blood Brain Barrier | + | 0.8879 | 88.79% |
Human oral bioavailability | + | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.7942 | 79.42% |
OATP2B1 inhibitior | - | 0.8594 | 85.94% |
OATP1B1 inhibitior | + | 0.9254 | 92.54% |
OATP1B3 inhibitior | + | 0.9465 | 94.65% |
MATE1 inhibitior | - | 0.7600 | 76.00% |
OCT2 inhibitior | + | 0.6428 | 64.28% |
BSEP inhibitior | + | 0.9310 | 93.10% |
P-glycoprotein inhibitior | - | 0.4703 | 47.03% |
P-glycoprotein substrate | - | 0.7895 | 78.95% |
CYP3A4 substrate | + | 0.6149 | 61.49% |
CYP2C9 substrate | - | 0.7813 | 78.13% |
CYP2D6 substrate | - | 0.8230 | 82.30% |
CYP3A4 inhibition | + | 0.6217 | 62.17% |
CYP2C9 inhibition | - | 0.6155 | 61.55% |
CYP2C19 inhibition | - | 0.6141 | 61.41% |
CYP2D6 inhibition | - | 0.7773 | 77.73% |
CYP1A2 inhibition | + | 0.9339 | 93.39% |
CYP2C8 inhibition | - | 0.5844 | 58.44% |
CYP inhibitory promiscuity | + | 0.7242 | 72.42% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.6377 | 63.77% |
Eye corrosion | - | 0.9906 | 99.06% |
Eye irritation | - | 0.9230 | 92.30% |
Skin irritation | - | 0.8259 | 82.59% |
Skin corrosion | - | 0.9569 | 95.69% |
Ames mutagenesis | + | 0.6200 | 62.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4794 | 47.94% |
Micronuclear | + | 0.8100 | 81.00% |
Hepatotoxicity | + | 0.6698 | 66.98% |
skin sensitisation | - | 0.9229 | 92.29% |
Respiratory toxicity | + | 0.8000 | 80.00% |
Reproductive toxicity | + | 0.9667 | 96.67% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | - | 0.6779 | 67.79% |
Acute Oral Toxicity (c) | II | 0.5811 | 58.11% |
Estrogen receptor binding | + | 0.9068 | 90.68% |
Androgen receptor binding | + | 0.6880 | 68.80% |
Thyroid receptor binding | + | 0.7223 | 72.23% |
Glucocorticoid receptor binding | + | 0.8566 | 85.66% |
Aromatase binding | + | 0.5982 | 59.82% |
PPAR gamma | + | 0.8158 | 81.58% |
Honey bee toxicity | - | 0.8966 | 89.66% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.6900 | 69.00% |
Fish aquatic toxicity | - | 0.8463 | 84.63% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
14125.4 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
1780 nM |
IC50 |
PMID: 12852960
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
2920 nM |
IC50 |
PMID: 12852960
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
84 nM 84 nM |
IC50 IC50 |
PMID: 12852960
via Super-PRED |
CHEMBL206 | P03372 | Estrogen receptor alpha |
17183.79 nM |
IC50 |
via CMAUP
|
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
794.3 nM 794.3 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
3548.1 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
1778.3 nM |
Potency |
via CMAUP
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
199.5 nM 199.5 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
251.2 nM 251.2 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL6101 | P42224 | Signal transducer and activator of transcription 1-alpha/beta |
<
2.83 nM 2.83 nM |
EC50 EC50 |
via CMAUP
via Super-PRED |
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
1584.9 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.05% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.88% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.71% | 91.11% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 95.65% | 92.67% |
CHEMBL2581 | P07339 | Cathepsin D | 95.37% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.61% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.61% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.55% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.57% | 99.23% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 92.29% | 96.47% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.21% | 93.40% |
CHEMBL2535 | P11166 | Glucose transporter | 91.60% | 98.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.40% | 91.49% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.39% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.29% | 86.33% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 89.76% | 97.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 89.31% | 92.98% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 88.93% | 85.49% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.44% | 90.00% |
CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 87.42% | 95.70% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.09% | 97.36% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 85.06% | 96.39% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.69% | 96.67% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.60% | 91.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.39% | 96.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.12% | 93.31% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 83.80% | 98.59% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.80% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 378227 |
NPASS | NPC157931 |
ChEMBL | CHEMBL85826 |
LOTUS | LTS0253130 |
wikiData | Q104403647 |