Homodidrovaltrate
Internal ID | 5fea2abb-dab4-40bd-b104-c95bf8a38642 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Iridoids and derivatives |
IUPAC Name | [6-acetyloxy-4-(3-methylbutanoyloxymethyl)spiro[4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7,2'-oxirane]-1-yl] 3-methylpentanoate |
SMILES (Canonical) | CCC(C)CC(=O)OC1C2C(CC(C23CO3)OC(=O)C)C(=CO1)COC(=O)CC(C)C |
SMILES (Isomeric) | CCC(C)CC(=O)OC1C2C(CC(C23CO3)OC(=O)C)C(=CO1)COC(=O)CC(C)C |
InChI | InChI=1S/C23H34O8/c1-6-14(4)8-20(26)31-22-21-17(9-18(30-15(5)24)23(21)12-29-23)16(11-28-22)10-27-19(25)7-13(2)3/h11,13-14,17-18,21-22H,6-10,12H2,1-5H3 |
InChI Key | NQYKVDKWBKOHRD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H34O8 |
Molecular Weight | 438.50 g/mol |
Exact Mass | 438.22536804 g/mol |
Topological Polar Surface Area (TPSA) | 101.00 Ų |
XlogP | 2.80 |
Homodihydroisovaltratum |
Homodihydroisovalepotriate |
NQYKVDKWBKOHRD-UHFFFAOYSA-N |
6-Acetoxy-4-((3-methylbutanoyloxy)methyl)-4a,5,6,7a-tetrahydro-1H-spiro[cyclopenta[c]pyran-7,2'-oxirane]-1-yl 3-methylpentanoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.12% | 96.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 96.55% | 97.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.12% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.70% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.66% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.32% | 91.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.89% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.56% | 86.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.07% | 97.79% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.92% | 91.19% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.83% | 97.25% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.63% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.63% | 85.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.40% | 89.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.52% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.13% | 95.89% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.10% | 89.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.74% | 82.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.55% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Valeriana capensis |
Valeriana jatamansi |
Valeriana officinalis |
Valeriana pulchella |
PubChem | 12958352 |
LOTUS | LTS0156366 |
wikiData | Q104392603 |