Hoduloside II
Internal ID | c463195f-07e8-4e62-b920-0c8126daa709 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | 7-[5-hydroxy-6-(hydroxymethyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-2-[3-(2-hydroxy-4-methylpent-3-enyl)-3-methyloxiran-2-yl]-4b,8,8,10a-tetramethylspiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,4'-oxolane]-2'-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CCC4(C5CCC(C6(C5(CCC4C3(C)C)C)CC(=O)OC6)C7C(O7)(C)CC(C=C(C)C)O)C)CO)O)OC8C(C(C(C(O8)CO)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CCC4(C5CCC(C6(C5(CCC4C3(C)C)C)CC(=O)OC6)C7C(O7)(C)CC(C=C(C)C)O)C)CO)O)OC8C(C(C(C(O8)CO)O)O)O)O)O)O |
InChI | InChI=1S/C48H78O19/c1-21(2)15-23(51)16-47(8)40(67-47)24-9-10-28-45(6)13-12-29(44(4,5)27(45)11-14-46(28,7)48(24)17-30(52)60-20-48)64-43-39(66-41-36(58)34(56)31(53)22(3)61-41)38(33(55)26(19-50)63-43)65-42-37(59)35(57)32(54)25(18-49)62-42/h15,22-29,31-43,49-51,53-59H,9-14,16-20H2,1-8H3 |
InChI Key | WGBVZRNBBJVXAT-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C48H78O19 |
Molecular Weight | 959.10 g/mol |
Exact Mass | 958.51373025 g/mol |
Topological Polar Surface Area (TPSA) | 297.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.05% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.12% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.11% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.31% | 94.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.93% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.74% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.58% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.52% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.30% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.28% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.64% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.86% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.19% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.48% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.77% | 97.36% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.45% | 97.25% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.45% | 96.77% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.68% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.48% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.63% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.54% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.42% | 94.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.55% | 91.24% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.03% | 97.47% |
CHEMBL4683 | Q12884 | Fibroblast activation protein alpha | 81.01% | 93.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.76% | 97.14% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.64% | 92.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.42% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hovenia dulcis |
PubChem | 131752537 |
LOTUS | LTS0125158 |
wikiData | Q104251321 |