Hippagine
Internal ID | 5459f02a-bcfc-47b0-bade-54b7a169e83a |
Taxonomy | Organoheterocyclic compounds > Benzazepines |
IUPAC Name | 5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,17-tetraene-15,16-diol |
SMILES (Canonical) | C1C(C(C=C2C1N3CC2C4=CC5=C(C=C4C3)OCO5)O)O |
SMILES (Isomeric) | C1C(C(C=C2C1N3CC2C4=CC5=C(C=C4C3)OCO5)O)O |
InChI | InChI=1S/C16H17NO4/c18-13-2-10-11-6-17(12(10)4-14(13)19)5-8-1-15-16(3-9(8)11)21-7-20-15/h1-3,11-14,18-19H,4-7H2 |
InChI Key | JKZMYBLUKAMPKM-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C16H17NO4 |
Molecular Weight | 287.31 g/mol |
Exact Mass | 287.11575802 g/mol |
Topological Polar Surface Area (TPSA) | 62.20 Ų |
XlogP | 0.00 |
(-)-Pancracine |
21416-14-8 |
5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,17-tetraene-15,16-diol |
CHEBI:181611 |
JKZMYBLUKAMPKM-UHFFFAOYSA-N |
AKOS040735338 |
NCGC00385948-01 |
[6aS-(6.beta.,6a.alpha.,8.alpha.,9.beta.,11.beta.)]-5,6a,7,8,9,11-Hex ahydro-6,11-methano-6H-1,3-benzodioxolo[5,6-c][1]benzazepine-8,9-diol |
6,11-Methano-6H-1,3-benzodioxolo[5,6-c][1]benzazepine-8,9-diol, 5,6a,7,8,9,11-hexahydro-, [6aS-(6.beta.,6a.alpha.,8.alpha.,9.beta.,11.beta.)]- |
NCGC00385948-01_C16H17NO4_6,11-Methano-6H-benzo[b]-1,3-benzodioxolo[5,6-e]azepine-8,9-diol, 5,6a,7,8,9,11-hexahydro- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.06% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.23% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.25% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.70% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.24% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.55% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.13% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.81% | 89.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.56% | 85.14% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.05% | 80.96% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.96% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.76% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.68% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.55% | 86.33% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 82.02% | 96.11% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.83% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amaryllis belladonna |
Narcissus poeticus subsp. radiiflorus |
Pancratium canariense |
Pancratium sickenbergeri |
PubChem | 625481 |
LOTUS | LTS0052298 |
wikiData | Q105130590 |