heteroclitalignan D
Internal ID | 7884d477-4b28-4511-8443-016d860a6b46 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(8S,9S,10S,11R)-8-acetyloxy-9-hydroxy-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] benzoate |
SMILES (Canonical) | CC1C(C2=CC3=C(C(=C2C4=C(C(=C(C=C4C(C1(C)O)OC(=O)C)OC)OC)OC)OC)OCO3)OC(=O)C5=CC=CC=C5 |
SMILES (Isomeric) | C[C@H]1[C@H](C2=CC3=C(C(=C2C4=C(C(=C(C=C4[C@@H]([C@@]1(C)O)OC(=O)C)OC)OC)OC)OC)OCO3)OC(=O)C5=CC=CC=C5 |
InChI | InChI=1S/C32H34O11/c1-16-25(43-31(34)18-11-9-8-10-12-18)19-13-22-27(41-15-40-22)29(39-7)23(19)24-20(30(32(16,3)35)42-17(2)33)14-21(36-4)26(37-5)28(24)38-6/h8-14,16,25,30,35H,15H2,1-7H3/t16-,25+,30-,32-/m0/s1 |
InChI Key | UJJWRJWLPZAYGS-MLDYHGJLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C32H34O11 |
Molecular Weight | 594.60 g/mol |
Exact Mass | 594.21011190 g/mol |
Topological Polar Surface Area (TPSA) | 128.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.51% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.93% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.81% | 95.56% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 91.34% | 89.44% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.25% | 96.77% |
CHEMBL2535 | P11166 | Glucose transporter | 90.21% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 90.01% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.92% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.97% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.07% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.06% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.70% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.00% | 97.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.96% | 96.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.73% | 89.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.65% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.68% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 81.34% | 97.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.83% | 95.50% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.29% | 83.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura heteroclita |
PubChem | 154723703 |
LOTUS | LTS0083279 |
wikiData | Q105273994 |