Herbacetin 8-O-beta-D-glucopyranoside
Internal ID | 0f5666ab-b045-4a96-b2c7-79972f19acd3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-8-O-glycosides |
IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O |
InChI | InChI=1S/C21H20O12/c22-6-11-13(26)15(28)17(30)21(31-11)33-19-10(25)5-9(24)12-14(27)16(29)18(32-20(12)19)7-1-3-8(23)4-2-7/h1-5,11,13,15,17,21-26,28-30H,6H2/t11-,13-,15+,17-,21+/m1/s1 |
InChI Key | WWEKCPWUOZWBRI-KKPQBLLMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O12 |
Molecular Weight | 464.40 g/mol |
Exact Mass | 464.09547607 g/mol |
Topological Polar Surface Area (TPSA) | 207.00 Ų |
XlogP | 0.40 |
Herbacetin 8-O-beta-D-glucopyranoside |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.47% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.46% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.90% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.05% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.90% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.81% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.09% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.10% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 86.79% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.40% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.99% | 86.92% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.95% | 91.49% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.40% | 95.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.28% | 91.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.56% | 97.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.75% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium triquetrum |
PubChem | 20834275 |
LOTUS | LTS0240903 |
wikiData | Q105313950 |