Helicteric acid
Internal ID | 7a68cac0-09ef-4511-859a-2ff4a7a6b775 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,3aS,5aS,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-acetyloxy-5a-(benzoyloxymethyl)-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)COC(=O)C6=CC=CC=C6)C)(C)C)OC(=O)C)C)C(=O)O |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)COC(=O)C6=CC=CC=C6)C)(C)C)OC(=O)C)C)C(=O)O |
InChI | InChI=1S/C39H54O6/c1-24(2)27-15-20-38(34(42)43)21-22-39(23-44-33(41)26-11-9-8-10-12-26)28(32(27)38)13-14-30-36(6)18-17-31(45-25(3)40)35(4,5)29(36)16-19-37(30,39)7/h8-12,27-32H,1,13-23H2,2-7H3,(H,42,43)/t27-,28+,29-,30+,31-,32+,36-,37+,38-,39-/m0/s1 |
InChI Key | SOJNOTYSDQQXKS-LJVLTGEUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C39H54O6 |
Molecular Weight | 618.80 g/mol |
Exact Mass | 618.39203944 g/mol |
Topological Polar Surface Area (TPSA) | 89.90 Ų |
XlogP | 9.60 |
102637-04-7 |
Helictericacid |
CHEMBL3409099 |
![2D Structure of Helicteric acid 2D Structure of Helicteric acid](https://plantaedb.com/storage/docs/compounds/2023/11/helicteric-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.69% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.13% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.60% | 86.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.32% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 91.59% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.05% | 82.69% |
CHEMBL5028 | O14672 | ADAM10 | 88.89% | 97.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.87% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.84% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.56% | 91.11% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.97% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.88% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.73% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capparis zeylanica |
Helicteres angustifolia |
PubChem | 15940296 |
LOTUS | LTS0193642 |
wikiData | Q104988148 |