Hematoxylin
Internal ID | 70a5bb1f-3614-4196-b944-2db6e1ebbcec |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
IUPAC Name | (6aS,11bR)-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol |
SMILES (Canonical) | C1C2=CC(=C(C=C2C3C1(COC4=C3C=CC(=C4O)O)O)O)O |
SMILES (Isomeric) | C1C2=CC(=C(C=C2[C@H]3[C@@]1(COC4=C3C=CC(=C4O)O)O)O)O |
InChI | InChI=1S/C16H14O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,13,17-21H,5-6H2/t13-,16+/m0/s1 |
InChI Key | WZUVPPKBWHMQCE-XJKSGUPXSA-N |
Popularity | 6,256 references in papers |
Molecular Formula | C16H14O6 |
Molecular Weight | 302.28 g/mol |
Exact Mass | 302.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 1.20 |
Atomic LogP (AlogP) | 1.32 |
H-Bond Acceptor | 6 |
H-Bond Donor | 5 |
Rotatable Bonds | 0 |
Haematoxylin |
Hematoxyline |
Hydroxybrazilin |
517-28-2 |
Hydroxybrasilin |
Natural Black 1 |
Hematoxylin hydrate |
(+)-Hematoxylin |
hematoxiline |
(+)-haematoxylin |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9069 | 90.69% |
Caco-2 | - | 0.7838 | 78.38% |
Blood Brain Barrier | - | 0.5500 | 55.00% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.5926 | 59.26% |
OATP2B1 inhibitior | - | 0.5636 | 56.36% |
OATP1B1 inhibitior | + | 0.9414 | 94.14% |
OATP1B3 inhibitior | + | 0.9821 | 98.21% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | - | 0.8800 | 88.00% |
P-glycoprotein inhibitior | - | 0.9274 | 92.74% |
P-glycoprotein substrate | - | 0.8087 | 80.87% |
CYP3A4 substrate | + | 0.5195 | 51.95% |
CYP2C9 substrate | + | 0.6000 | 60.00% |
CYP2D6 substrate | + | 0.4194 | 41.94% |
CYP3A4 inhibition | - | 0.9112 | 91.12% |
CYP2C9 inhibition | - | 0.6159 | 61.59% |
CYP2C19 inhibition | + | 0.5296 | 52.96% |
CYP2D6 inhibition | - | 0.5902 | 59.02% |
CYP1A2 inhibition | + | 0.6714 | 67.14% |
CYP2C8 inhibition | - | 0.6151 | 61.51% |
CYP inhibitory promiscuity | - | 0.8353 | 83.53% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Warning | 0.5244 | 52.44% |
Eye corrosion | - | 0.9927 | 99.27% |
Eye irritation | + | 0.9629 | 96.29% |
Skin irritation | - | 0.6918 | 69.18% |
Skin corrosion | - | 0.9372 | 93.72% |
Ames mutagenesis | - | 0.9400 | 94.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7514 | 75.14% |
Micronuclear | + | 0.7159 | 71.59% |
Hepatotoxicity | - | 0.6750 | 67.50% |
skin sensitisation | - | 0.7931 | 79.31% |
Respiratory toxicity | + | 0.6889 | 68.89% |
Reproductive toxicity | + | 0.7556 | 75.56% |
Mitochondrial toxicity | + | 0.7500 | 75.00% |
Nephrotoxicity | - | 0.6889 | 68.89% |
Acute Oral Toxicity (c) | III | 0.4369 | 43.69% |
Estrogen receptor binding | + | 0.8136 | 81.36% |
Androgen receptor binding | + | 0.7319 | 73.19% |
Thyroid receptor binding | + | 0.7518 | 75.18% |
Glucocorticoid receptor binding | + | 0.8555 | 85.55% |
Aromatase binding | + | 0.6428 | 64.28% |
PPAR gamma | + | 0.5682 | 56.82% |
Honey bee toxicity | - | 0.7667 | 76.67% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | + | 0.6950 | 69.50% |
Fish aquatic toxicity | + | 0.6950 | 69.50% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
63.1 nM |
Potency |
via Super-PRED
|
CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 |
3400 nM |
IC50 |
PMID: 18610999
|
CHEMBL3650 | P11362 | Fibroblast growth factor receptor 1 |
320 nM |
IC50 |
PMID: 18610999
|
CHEMBL3717 | P08581 | Hepatocyte growth factor receptor |
400 nM |
IC50 |
PMID: 18610999
|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
125.9 nM |
Potency |
via Super-PRED
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
14125.4 nM 707.9 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
12589.3 nM 14125.4 nM 15848.9 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL1824 | P04626 | Receptor protein-tyrosine kinase erbB-2 |
960 nM |
IC50 |
PMID: 18610999
|
CHEMBL1936 | P10721 | Stem cell growth factor receptor |
2700 nM |
IC50 |
PMID: 18610999
|
CHEMBL267 | P12931 | Tyrosine-protein kinase SRC |
440 nM |
IC50 |
PMID: 18610999
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
251.2 nM 316.2 nM 1584.9 nM |
Potency Potency Potency |
via Super-PRED
via Super-PRED via CMAUP |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 |
2900 nM |
IC50 |
PMID: 18610999
|
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 |
2100 nM |
IC50 |
PMID: 18610999
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.75% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.01% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.49% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.61% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.23% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.77% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 84.36% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.57% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.67% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.59% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.20% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Biancaea sappan |
Haematoxylum campechianum |
PubChem | 442514 |
NPASS | NPC44530 |
ChEMBL | CHEMBL477197 |
LOTUS | LTS0120586 |
wikiData | Q1146112 |