H-Tyr-Leu-Leu-Val-Lys-OH
Internal ID | 5d17d864-d9a2-4d4d-aa46-bce64c24049b |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
SMILES (Canonical) | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CC1=CC=C(C=C1)O)N |
SMILES (Isomeric) | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@H](CC1=CC=C(C=C1)O)N |
InChI | InChI=1S/C32H54N6O7/c1-18(2)15-25(36-28(40)23(34)17-21-10-12-22(39)13-11-21)29(41)37-26(16-19(3)4)30(42)38-27(20(5)6)31(43)35-24(32(44)45)9-7-8-14-33/h10-13,18-20,23-27,39H,7-9,14-17,33-34H2,1-6H3,(H,35,43)(H,36,40)(H,37,41)(H,38,42)(H,44,45)/t23-,24-,25-,26-,27-/m0/s1 |
InChI Key | RQCUMDRLAXJWLZ-IRGGMKSGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H54N6O7 |
Molecular Weight | 634.80 g/mol |
Exact Mass | 634.40539808 g/mol |
Topological Polar Surface Area (TPSA) | 226.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.74% | 98.95% |
CHEMBL3837 | P07711 | Cathepsin L | 99.00% | 96.61% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.30% | 93.56% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.69% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.53% | 99.17% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 96.53% | 90.24% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 96.31% | 92.29% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.31% | 96.09% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.04% | 93.10% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 95.70% | 97.21% |
CHEMBL236 | P41143 | Delta opioid receptor | 95.22% | 99.35% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.14% | 94.45% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.72% | 97.23% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.01% | 90.20% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.42% | 100.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 92.22% | 85.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.06% | 91.11% |
CHEMBL237 | P41145 | Kappa opioid receptor | 91.43% | 98.10% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.51% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.95% | 95.50% |
CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 88.92% | 92.80% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.21% | 98.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.72% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.53% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.46% | 93.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.40% | 90.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.69% | 95.89% |
CHEMBL4072 | P07858 | Cathepsin B | 85.42% | 93.67% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 84.31% | 98.35% |
CHEMBL3776 | Q14790 | Caspase-8 | 83.83% | 97.06% |
CHEMBL3891 | P07384 | Calpain 1 | 83.72% | 93.04% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.46% | 96.00% |
CHEMBL3308 | P55212 | Caspase-6 | 81.89% | 97.56% |
CHEMBL1808 | P12821 | Angiotensin-converting enzyme | 81.70% | 93.39% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.68% | 91.71% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 81.47% | 82.86% |
CHEMBL2163183 | Q9NXA8 | NAD-dependent protein deacylase sirtuin-5, mitochondrial | 81.20% | 96.53% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.58% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phytolacca americana |
PubChem | 162898956 |
LOTUS | LTS0174556 |
wikiData | Q105275625 |