H-Leu-Gln-Gly-Ala-Ser-Leu-Lys-OH
| Internal ID | 18369d1f-f24f-47ee-adbf-f94fbc09bee0 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]propanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(CCC(=O)N)C(=O)NCC(=O)NC(C)C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)O)N |
| SMILES (Isomeric) | C[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)CNC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CC(C)C)N |
| InChI | InChI=1S/C31H57N9O10/c1-16(2)12-19(33)27(45)37-20(9-10-24(34)42)28(46)35-14-25(43)36-18(5)26(44)40-23(15-41)30(48)39-22(13-17(3)4)29(47)38-21(31(49)50)8-6-7-11-32/h16-23,41H,6-15,32-33H2,1-5H3,(H2,34,42)(H,35,46)(H,36,43)(H,37,45)(H,38,47)(H,39,48)(H,40,44)(H,49,50)/t18-,19-,20-,21-,22-,23-/m0/s1 |
| InChI Key | CVSCJYUBLBELRX-LLINQDLYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H57N9O10 |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.42283905 g/mol |
| Topological Polar Surface Area (TPSA) | 327.00 Ų |
| XlogP | -4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.76% | 83.82% |
| CHEMBL236 | P41143 | Delta opioid receptor | 99.38% | 99.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.14% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.84% | 89.63% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.18% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.91% | 93.56% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 97.39% | 98.94% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.16% | 97.23% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 97.04% | 98.10% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 96.89% | 100.00% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 96.60% | 96.67% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.33% | 98.05% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.13% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.69% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.79% | 100.00% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 94.32% | 98.89% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 94.30% | 99.77% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 94.22% | 96.28% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.98% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.85% | 96.47% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.65% | 93.10% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.41% | 91.11% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.38% | 95.71% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 93.33% | 98.33% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.27% | 98.33% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.96% | 97.21% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 91.74% | 87.45% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 91.55% | 96.73% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.81% | 97.29% |
| CHEMBL3837 | P07711 | Cathepsin L | 90.54% | 96.61% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.28% | 96.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.71% | 100.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 89.53% | 92.32% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.84% | 93.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 88.79% | 96.03% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 88.77% | 95.20% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.68% | 82.69% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.40% | 92.29% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 86.35% | 88.42% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.81% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.46% | 90.71% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.95% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.79% | 89.33% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 84.55% | 92.80% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.76% | 89.50% |
| CHEMBL3308 | P55212 | Caspase-6 | 83.73% | 97.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.71% | 96.95% |
| CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 83.54% | 88.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.98% | 82.86% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.40% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.35% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.23% | 94.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.06% | 96.90% |
| CHEMBL3776 | Q14790 | Caspase-8 | 81.93% | 97.06% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 81.90% | 98.24% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.55% | 91.38% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 81.54% | 97.43% |
| CHEMBL3234 | P08631 | Tyrosine-protein kinase HCK | 80.75% | 88.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phytolacca americana |
| PubChem | 162980336 |
| LOTUS | LTS0114459 |
| wikiData | Q104970964 |