H-Ile-Ser-Thr-Ala-Ile-Ala(imidazol-2-yl)-Asn-Ser-Lys-OH
| Internal ID | 22f7084d-53d5-4b5c-8e05-e50782b2d563 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]propanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-imidazol-2-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(C(C)CC)C(=O)NC(CC1=NC=CN1)C(=O)NC(CC(=O)N)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)O)N |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC1=NC=CN1)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)O)N |
| InChI | InChI=1S/C41H71N13O14/c1-7-19(3)30(44)38(64)52-27(18-56)37(63)54-32(22(6)57)40(66)47-21(5)33(59)53-31(20(4)8-2)39(65)50-25(16-29-45-13-14-46-29)35(61)49-24(15-28(43)58)34(60)51-26(17-55)36(62)48-23(41(67)68)11-9-10-12-42/h13-14,19-27,30-32,55-57H,7-12,15-18,42,44H2,1-6H3,(H2,43,58)(H,45,46)(H,47,66)(H,48,62)(H,49,61)(H,50,65)(H,51,60)(H,52,64)(H,53,59)(H,54,63)(H,67,68)/t19-,20-,21-,22+,23-,24-,25-,26-,27-,30-,31-,32-/m0/s1 |
| InChI Key | WDBUEXYJQPAORL-DAELXKLDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H71N13O14 |
| Molecular Weight | 970.10 g/mol |
| Exact Mass | 969.52434399 g/mol |
| Topological Polar Surface Area (TPSA) | 455.00 Ų |
| XlogP | -7.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.73% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.25% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.20% | 96.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.80% | 97.23% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 96.36% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.84% | 93.10% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.76% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.43% | 98.05% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 95.32% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.22% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.89% | 99.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.26% | 98.33% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 93.80% | 87.45% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 92.52% | 98.94% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.22% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.63% | 96.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 90.82% | 97.06% |
| CHEMBL3837 | P07711 | Cathepsin L | 89.36% | 96.61% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 88.69% | 88.42% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.31% | 100.00% |
| CHEMBL3308 | P55212 | Caspase-6 | 87.01% | 97.56% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.96% | 91.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.11% | 90.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.63% | 96.90% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.37% | 93.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.90% | 93.18% |
| CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 83.70% | 88.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.92% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.16% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.14% | 95.50% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.03% | 95.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.01% | 91.11% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 80.61% | 97.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phytolacca americana |
| PubChem | 163187101 |
| LOTUS | LTS0029578 |
| wikiData | Q105302218 |