H-Gly-DL-Tyr-DL-Ser-DL-Asp-DL-Pro-DL-Tyr-DL-Asp-DL-Asn-DL-Lys-OH
Internal ID | 7cb52878-c705-4ddd-93d5-d28b3fe313a6 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
IUPAC Name | 6-amino-2-[[4-amino-2-[[2-[[2-[[1-[2-[[2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
SMILES (Canonical) | C1CC(N(C1)C(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)CN)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC(CCCCN)C(=O)O |
SMILES (Isomeric) | C1CC(N(C1)C(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)CN)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC(CCCCN)C(=O)O |
InChI | InChI=1S/C46H63N11O18/c47-14-2-1-4-27(46(74)75)51-41(69)30(18-35(49)61)52-42(70)31(19-37(63)64)53-40(68)29(17-24-8-12-26(60)13-9-24)54-44(72)34-5-3-15-57(34)45(73)32(20-38(65)66)55-43(71)33(22-58)56-39(67)28(50-36(62)21-48)16-23-6-10-25(59)11-7-23/h6-13,27-34,58-60H,1-5,14-22,47-48H2,(H2,49,61)(H,50,62)(H,51,69)(H,52,70)(H,53,68)(H,54,72)(H,55,71)(H,56,67)(H,63,64)(H,65,66)(H,74,75) |
InChI Key | UBSPOCHIBQANRN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H63N11O18 |
Molecular Weight | 1058.10 g/mol |
Exact Mass | 1057.43525420 g/mol |
Topological Polar Surface Area (TPSA) | 492.00 Ų |
XlogP | -9.50 |
Atomic LogP (AlogP) | -5.74 |
H-Bond Acceptor | 17 |
H-Bond Donor | 16 |
Rotatable Bonds | 31 |
There are no found synonyms. |
![2D Structure of H-Gly-DL-Tyr-DL-Ser-DL-Asp-DL-Pro-DL-Tyr-DL-Asp-DL-Asn-DL-Lys-OH 2D Structure of H-Gly-DL-Tyr-DL-Ser-DL-Asp-DL-Pro-DL-Tyr-DL-Asp-DL-Asn-DL-Lys-OH](https://plantaedb.com/storage/docs/compounds/2023/11/h-gly-dl-tyr-dl-ser-dl-asp-dl-pro-dl-tyr-dl-asp-dl-asn-dl-lys-oh.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7131 | 71.31% |
Caco-2 | - | 0.8644 | 86.44% |
Blood Brain Barrier | - | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Mitochondria | 0.5271 | 52.71% |
OATP2B1 inhibitior | - | 0.7165 | 71.65% |
OATP1B1 inhibitior | + | 0.8850 | 88.50% |
OATP1B3 inhibitior | + | 0.9363 | 93.63% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.9260 | 92.60% |
P-glycoprotein inhibitior | + | 0.7434 | 74.34% |
P-glycoprotein substrate | + | 0.7642 | 76.42% |
CYP3A4 substrate | + | 0.7020 | 70.20% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8006 | 80.06% |
CYP3A4 inhibition | - | 0.8840 | 88.40% |
CYP2C9 inhibition | - | 0.9365 | 93.65% |
CYP2C19 inhibition | - | 0.8776 | 87.76% |
CYP2D6 inhibition | - | 0.8966 | 89.66% |
CYP1A2 inhibition | - | 0.9382 | 93.82% |
CYP2C8 inhibition | + | 0.5440 | 54.40% |
CYP inhibitory promiscuity | - | 0.9175 | 91.75% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.8800 | 88.00% |
Carcinogenicity (trinary) | Non-required | 0.6543 | 65.43% |
Eye corrosion | - | 0.9908 | 99.08% |
Eye irritation | - | 0.8978 | 89.78% |
Skin irritation | - | 0.7810 | 78.10% |
Skin corrosion | - | 0.9415 | 94.15% |
Ames mutagenesis | - | 0.8200 | 82.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7052 | 70.52% |
Micronuclear | + | 0.9200 | 92.00% |
Hepatotoxicity | - | 0.5799 | 57.99% |
skin sensitisation | - | 0.9021 | 90.21% |
Respiratory toxicity | + | 0.8556 | 85.56% |
Reproductive toxicity | + | 0.9556 | 95.56% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | - | 0.8470 | 84.70% |
Acute Oral Toxicity (c) | III | 0.5859 | 58.59% |
Estrogen receptor binding | + | 0.7724 | 77.24% |
Androgen receptor binding | + | 0.6964 | 69.64% |
Thyroid receptor binding | - | 0.4882 | 48.82% |
Glucocorticoid receptor binding | - | 0.5142 | 51.42% |
Aromatase binding | + | 0.6038 | 60.38% |
PPAR gamma | + | 0.6938 | 69.38% |
Honey bee toxicity | - | 0.8146 | 81.46% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
Fish aquatic toxicity | + | 0.6755 | 67.55% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.43% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 99.25% | 90.20% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.93% | 100.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.59% | 93.10% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.33% | 98.33% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.90% | 97.23% |
CHEMBL4123 | P30989 | Neurotensin receptor 1 | 97.61% | 96.67% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.07% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.05% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.78% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 96.78% | 82.69% |
CHEMBL3837 | P07711 | Cathepsin L | 96.75% | 96.61% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 96.74% | 96.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.71% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.60% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.03% | 93.00% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 94.03% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 93.85% | 98.10% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.84% | 91.19% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 92.71% | 98.24% |
CHEMBL2319 | P06870 | Kallikrein 1 | 92.59% | 90.95% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.21% | 95.17% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 92.00% | 98.94% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 91.83% | 82.86% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 91.79% | 96.03% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.71% | 90.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.65% | 97.21% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 91.04% | 83.14% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 91.00% | 88.42% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.19% | 95.89% |
CHEMBL236 | P41143 | Delta opioid receptor | 89.24% | 99.35% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.84% | 85.00% |
CHEMBL3176 | O43603 | Galanin receptor 2 | 88.80% | 98.89% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 88.72% | 99.17% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 88.44% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.90% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.71% | 95.89% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.36% | 89.63% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.20% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.09% | 95.56% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 86.79% | 97.64% |
CHEMBL4801 | P29466 | Caspase-1 | 86.62% | 96.85% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.58% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.21% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.21% | 99.15% |
CHEMBL1921 | P47901 | Vasopressin V1b receptor | 85.10% | 92.50% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.92% | 89.33% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.41% | 82.38% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 84.37% | 93.33% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.84% | 97.64% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 83.02% | 100.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.67% | 93.18% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 82.60% | 97.98% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.59% | 95.50% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.51% | 96.25% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.39% | 94.66% |
CHEMBL2327 | P21452 | Neurokinin 2 receptor | 81.35% | 98.89% |
CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 81.03% | 98.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.37% | 97.14% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.32% | 94.62% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.10% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phytolacca americana |
PubChem | 162957624 |
LOTUS | LTS0003896 |
wikiData | Q105269625 |