H-DL-Val-DL-Leu-DL-Asp-DL-Leu-DL-Glu-DL-Glu-DL-Asn-DL-Trp-Gly-DL-Lys-OH
Internal ID | 8cee2948-3081-4ce3-88f2-175a63a20445 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
IUPAC Name | 6-amino-2-[[2-[[2-[[4-amino-2-[[2-[[2-[[2-[[2-[[2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoyl]amino]-3-carboxypropanoyl]amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
SMILES (Canonical) | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NCC(=O)NC(CCCCN)C(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)N |
SMILES (Isomeric) | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NCC(=O)NC(CCCCN)C(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)N |
InChI | InChI=1S/C54H83N13O18/c1-26(2)19-35(63-52(82)39(23-44(74)75)66-50(80)36(20-27(3)4)67-53(83)45(57)28(5)6)49(79)62-32(14-16-42(70)71)47(77)61-33(15-17-43(72)73)48(78)65-38(22-40(56)68)51(81)64-37(21-29-24-58-31-12-8-7-11-30(29)31)46(76)59-25-41(69)60-34(54(84)85)13-9-10-18-55/h7-8,11-12,24,26-28,32-39,45,58H,9-10,13-23,25,55,57H2,1-6H3,(H2,56,68)(H,59,76)(H,60,69)(H,61,77)(H,62,79)(H,63,82)(H,64,81)(H,65,78)(H,66,80)(H,67,83)(H,70,71)(H,72,73)(H,74,75)(H,84,85) |
InChI Key | IWGJXYUYDHTZHT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H83N13O18 |
Molecular Weight | 1202.30 g/mol |
Exact Mass | 1201.59790285 g/mol |
Topological Polar Surface Area (TPSA) | 522.00 Ų |
XlogP | -6.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.86% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.74% | 91.11% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 99.49% | 90.20% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.01% | 83.82% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.49% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.00% | 96.09% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.54% | 97.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.35% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.84% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.79% | 95.56% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 94.42% | 96.28% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.03% | 93.56% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.98% | 98.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.24% | 89.62% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 92.02% | 83.10% |
CHEMBL4801 | P29466 | Caspase-1 | 91.78% | 96.85% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.85% | 100.00% |
CHEMBL3176 | O43603 | Galanin receptor 2 | 90.64% | 98.89% |
CHEMBL3837 | P07711 | Cathepsin L | 90.18% | 96.61% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 89.35% | 88.42% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 89.16% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.63% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.53% | 94.45% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.24% | 97.21% |
CHEMBL2535 | P11166 | Glucose transporter | 86.80% | 98.75% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.57% | 87.45% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.06% | 100.00% |
CHEMBL3776 | Q14790 | Caspase-8 | 85.96% | 97.06% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.85% | 99.15% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.13% | 100.00% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 84.02% | 82.86% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.77% | 96.90% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.42% | 98.05% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.39% | 95.56% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 83.34% | 98.94% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 83.33% | 96.67% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.03% | 96.47% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.72% | 88.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.70% | 94.73% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.42% | 93.18% |
CHEMBL5028 | O14672 | ADAM10 | 82.20% | 97.50% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.40% | 89.33% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.85% | 89.50% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.62% | 95.48% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.57% | 82.69% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 80.17% | 96.67% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 80.13% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phytolacca americana |
PubChem | 163081788 |
LOTUS | LTS0140577 |
wikiData | Q105121606 |