H-Asp-Phe-Ser-Pro-Asn-Asp-Lys-OH
Internal ID | adf06ce1-a18c-403e-97c9-84e383309689 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid |
SMILES (Canonical) | C1CC(N(C1)C(=O)C(CO)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)O)N)C(=O)NC(CC(=O)N)C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)O |
SMILES (Isomeric) | C1C[C@H](N(C1)C(=O)[C@H](CO)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC(=O)O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O |
InChI | InChI=1S/C35H51N9O14/c36-11-5-4-9-20(35(57)58)39-32(54)23(16-28(49)50)41-31(53)22(15-26(38)46)42-33(55)25-10-6-12-44(25)34(56)24(17-45)43-30(52)21(13-18-7-2-1-3-8-18)40-29(51)19(37)14-27(47)48/h1-3,7-8,19-25,45H,4-6,9-17,36-37H2,(H2,38,46)(H,39,54)(H,40,51)(H,41,53)(H,42,55)(H,43,52)(H,47,48)(H,49,50)(H,57,58)/t19-,20-,21-,22-,23-,24-,25-/m0/s1 |
InChI Key | INWBEIPEODGOPI-HUVRVWIJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H51N9O14 |
Molecular Weight | 821.80 g/mol |
Exact Mass | 821.35554733 g/mol |
Topological Polar Surface Area (TPSA) | 393.00 Ų |
XlogP | -9.40 |
Atomic LogP (AlogP) | -5.00 |
H-Bond Acceptor | 13 |
H-Bond Donor | 12 |
Rotatable Bonds | 25 |
There are no found synonyms. |
![2D Structure of H-Asp-Phe-Ser-Pro-Asn-Asp-Lys-OH 2D Structure of H-Asp-Phe-Ser-Pro-Asn-Asp-Lys-OH](https://plantaedb.com/storage/docs/compounds/2023/11/h-asp-phe-ser-pro-asn-asp-lys-oh.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.5760 | 57.60% |
Caco-2 | - | 0.8813 | 88.13% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Mitochondria | 0.5879 | 58.79% |
OATP2B1 inhibitior | - | 0.5792 | 57.92% |
OATP1B1 inhibitior | + | 0.8968 | 89.68% |
OATP1B3 inhibitior | + | 0.9407 | 94.07% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.8862 | 88.62% |
BSEP inhibitior | + | 0.7757 | 77.57% |
P-glycoprotein inhibitior | + | 0.7374 | 73.74% |
P-glycoprotein substrate | + | 0.7269 | 72.69% |
CYP3A4 substrate | + | 0.6910 | 69.10% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8015 | 80.15% |
CYP3A4 inhibition | - | 0.9560 | 95.60% |
CYP2C9 inhibition | - | 0.9662 | 96.62% |
CYP2C19 inhibition | - | 0.8882 | 88.82% |
CYP2D6 inhibition | - | 0.9505 | 95.05% |
CYP1A2 inhibition | - | 0.9160 | 91.60% |
CYP2C8 inhibition | - | 0.6295 | 62.95% |
CYP inhibitory promiscuity | - | 0.9752 | 97.52% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.8900 | 89.00% |
Carcinogenicity (trinary) | Non-required | 0.6878 | 68.78% |
Eye corrosion | - | 0.9881 | 98.81% |
Eye irritation | - | 0.9052 | 90.52% |
Skin irritation | - | 0.7637 | 76.37% |
Skin corrosion | - | 0.9394 | 93.94% |
Ames mutagenesis | - | 0.8400 | 84.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5157 | 51.57% |
Micronuclear | + | 0.8200 | 82.00% |
Hepatotoxicity | - | 0.5370 | 53.70% |
skin sensitisation | - | 0.9015 | 90.15% |
Respiratory toxicity | + | 0.9444 | 94.44% |
Reproductive toxicity | + | 0.9667 | 96.67% |
Mitochondrial toxicity | + | 0.9000 | 90.00% |
Nephrotoxicity | - | 0.8003 | 80.03% |
Acute Oral Toxicity (c) | III | 0.5750 | 57.50% |
Estrogen receptor binding | + | 0.8123 | 81.23% |
Androgen receptor binding | + | 0.5812 | 58.12% |
Thyroid receptor binding | + | 0.5162 | 51.62% |
Glucocorticoid receptor binding | - | 0.5592 | 55.92% |
Aromatase binding | + | 0.6006 | 60.06% |
PPAR gamma | + | 0.7297 | 72.97% |
Honey bee toxicity | - | 0.8585 | 85.85% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5700 | 57.00% |
Fish aquatic toxicity | - | 0.5569 | 55.69% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.66% | 98.33% |
CHEMBL2581 | P07339 | Cathepsin D | 99.58% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 99.17% | 90.20% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 98.41% | 82.69% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.32% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.11% | 96.09% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 97.09% | 96.03% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.83% | 90.17% |
CHEMBL4123 | P30989 | Neurotensin receptor 1 | 96.72% | 96.67% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 96.42% | 98.24% |
CHEMBL237 | P41145 | Kappa opioid receptor | 96.22% | 98.10% |
CHEMBL4801 | P29466 | Caspase-1 | 95.12% | 96.85% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.77% | 97.64% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 94.36% | 96.67% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.36% | 91.11% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.36% | 93.00% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 93.10% | 88.42% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.72% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.42% | 93.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.11% | 97.09% |
CHEMBL2327 | P21452 | Neurokinin 2 receptor | 91.76% | 98.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.75% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.63% | 99.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.58% | 100.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.72% | 83.82% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.53% | 97.23% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 89.02% | 96.25% |
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 89.01% | 97.43% |
CHEMBL3837 | P07711 | Cathepsin L | 88.73% | 96.61% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.64% | 91.19% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.50% | 91.81% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 87.74% | 93.33% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 87.11% | 98.94% |
CHEMBL3468 | P55210 | Caspase-7 | 85.74% | 95.68% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.54% | 97.14% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.38% | 97.21% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.93% | 93.10% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.46% | 90.71% |
CHEMBL2319 | P06870 | Kallikrein 1 | 84.46% | 90.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.46% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.39% | 94.45% |
CHEMBL5028 | O14672 | ADAM10 | 83.42% | 97.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.71% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.28% | 94.62% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.24% | 82.86% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.91% | 95.89% |
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 81.70% | 95.52% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.15% | 95.00% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 80.75% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.75% | 96.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.12% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phytolacca americana |
PubChem | 162856718 |
LOTUS | LTS0095384 |
wikiData | Q105116465 |