H-Asn-Tyr-Val-Asn-Gly-Thr-Cys-Gln-Ala-Thr-OH
Internal ID | af3a64b1-3ae4-43f1-a859-8d731e87cb34 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
IUPAC Name | (2S,3R)-2-[[(2S)-2-[[(2S)-5-amino-2-[[(2R)-2-[[(2S,3R)-2-[[2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]propanoyl]amino]-3-hydroxybutanoic acid |
SMILES (Canonical) | CC(C)C(C(=O)NC(CC(=O)N)C(=O)NCC(=O)NC(C(C)O)C(=O)NC(CS)C(=O)NC(CCC(=O)N)C(=O)NC(C)C(=O)NC(C(C)O)C(=O)O)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CC(=O)N)N |
SMILES (Isomeric) | C[C@H]([C@@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)O)C(=O)O)NC(=O)CNC(=O)[C@H](CC(=O)N)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)[C@H](CC(=O)N)N)O |
InChI | InChI=1S/C43H67N13O17S/c1-17(2)32(55-39(68)25(12-21-6-8-22(59)9-7-21)51-36(65)23(44)13-29(46)61)41(70)52-26(14-30(47)62)37(66)48-15-31(63)54-33(19(4)57)42(71)53-27(16-74)40(69)50-24(10-11-28(45)60)38(67)49-18(3)35(64)56-34(20(5)58)43(72)73/h6-9,17-20,23-27,32-34,57-59,74H,10-16,44H2,1-5H3,(H2,45,60)(H2,46,61)(H2,47,62)(H,48,66)(H,49,67)(H,50,69)(H,51,65)(H,52,70)(H,53,71)(H,54,63)(H,55,68)(H,56,64)(H,72,73)/t18-,19+,20+,23-,24-,25-,26-,27-,32-,33-,34-/m0/s1 |
InChI Key | FHYXTNUXKMIPLB-UIMSZJTRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H67N13O17S |
Molecular Weight | 1070.10 g/mol |
Exact Mass | 1069.44985889 g/mol |
Topological Polar Surface Area (TPSA) | 516.00 Ų |
XlogP | -9.00 |
Atomic LogP (AlogP) | -8.28 |
H-Bond Acceptor | 18 |
H-Bond Donor | 18 |
Rotatable Bonds | 32 |
There are no found synonyms. |
![2D Structure of H-Asn-Tyr-Val-Asn-Gly-Thr-Cys-Gln-Ala-Thr-OH 2D Structure of H-Asn-Tyr-Val-Asn-Gly-Thr-Cys-Gln-Ala-Thr-OH](https://plantaedb.com/storage/docs/compounds/2023/11/h-asn-tyr-val-asn-gly-thr-cys-gln-ala-thr-oh.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7594 | 75.94% |
Caco-2 | - | 0.8645 | 86.45% |
Blood Brain Barrier | - | 0.7250 | 72.50% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.6687 | 66.87% |
OATP2B1 inhibitior | - | 0.8570 | 85.70% |
OATP1B1 inhibitior | + | 0.8686 | 86.86% |
OATP1B3 inhibitior | + | 0.9426 | 94.26% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | + | 0.9259 | 92.59% |
P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
P-glycoprotein substrate | + | 0.8424 | 84.24% |
CYP3A4 substrate | + | 0.6721 | 67.21% |
CYP2C9 substrate | - | 0.5967 | 59.67% |
CYP2D6 substrate | - | 0.7961 | 79.61% |
CYP3A4 inhibition | - | 0.8956 | 89.56% |
CYP2C9 inhibition | - | 0.8967 | 89.67% |
CYP2C19 inhibition | - | 0.8398 | 83.98% |
CYP2D6 inhibition | - | 0.9257 | 92.57% |
CYP1A2 inhibition | - | 0.8890 | 88.90% |
CYP2C8 inhibition | + | 0.5857 | 58.57% |
CYP inhibitory promiscuity | - | 0.9567 | 95.67% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.8600 | 86.00% |
Carcinogenicity (trinary) | Non-required | 0.6833 | 68.33% |
Eye corrosion | - | 0.9896 | 98.96% |
Eye irritation | - | 0.8981 | 89.81% |
Skin irritation | - | 0.8040 | 80.40% |
Skin corrosion | - | 0.9401 | 94.01% |
Ames mutagenesis | - | 0.6600 | 66.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6733 | 67.33% |
Micronuclear | + | 0.7100 | 71.00% |
Hepatotoxicity | - | 0.6000 | 60.00% |
skin sensitisation | - | 0.8859 | 88.59% |
Respiratory toxicity | + | 0.7889 | 78.89% |
Reproductive toxicity | + | 0.8333 | 83.33% |
Mitochondrial toxicity | + | 0.6875 | 68.75% |
Nephrotoxicity | - | 0.7034 | 70.34% |
Acute Oral Toxicity (c) | III | 0.6955 | 69.55% |
Estrogen receptor binding | + | 0.7680 | 76.80% |
Androgen receptor binding | + | 0.6748 | 67.48% |
Thyroid receptor binding | + | 0.5737 | 57.37% |
Glucocorticoid receptor binding | + | 0.6370 | 63.70% |
Aromatase binding | + | 0.6824 | 68.24% |
PPAR gamma | + | 0.7667 | 76.67% |
Honey bee toxicity | - | 0.7931 | 79.31% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | - | 0.7600 | 76.00% |
Fish aquatic toxicity | - | 0.5704 | 57.04% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.91% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.84% | 83.82% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 99.51% | 97.23% |
CHEMBL236 | P41143 | Delta opioid receptor | 99.11% | 99.35% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 98.44% | 90.20% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.29% | 90.17% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 98.16% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.44% | 100.00% |
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 96.39% | 91.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.30% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.52% | 96.09% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.62% | 93.10% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.50% | 99.17% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 94.21% | 98.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.68% | 91.11% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 92.42% | 99.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.24% | 97.21% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 91.96% | 85.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.09% | 95.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.76% | 93.56% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 89.72% | 89.33% |
CHEMBL3176 | O43603 | Galanin receptor 2 | 89.27% | 98.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.74% | 96.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.45% | 93.00% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 86.05% | 96.67% |
CHEMBL2535 | P11166 | Glucose transporter | 86.01% | 98.75% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.56% | 92.29% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.51% | 97.93% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.47% | 95.17% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.18% | 96.67% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 84.94% | 97.88% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 84.79% | 89.63% |
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 84.20% | 95.52% |
CHEMBL3308 | P55212 | Caspase-6 | 84.05% | 97.56% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.51% | 98.05% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 83.51% | 96.28% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.28% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.23% | 95.56% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 82.82% | 95.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.73% | 95.38% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.58% | 94.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.53% | 89.50% |
CHEMBL3018 | Q9Y5Y6 | Matriptase | 81.53% | 98.33% |
CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 81.41% | 98.33% |
CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 81.29% | 88.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.67% | 90.71% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.41% | 96.03% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.15% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phytolacca americana |
PubChem | 163188784 |
LOTUS | LTS0235950 |
wikiData | Q104995527 |