H-Asn-Glu-Ala-Lys-OH
Internal ID | 667936d4-f540-4609-8a8b-60f7409a2e2b |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-4-carboxy-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]butanoyl]amino]propanoyl]amino]hexanoic acid |
SMILES (Canonical) | CC(C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)N)N |
SMILES (Isomeric) | C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)N)N |
InChI | InChI=1S/C18H32N6O8/c1-9(15(28)24-12(18(31)32)4-2-3-7-19)22-17(30)11(5-6-14(26)27)23-16(29)10(20)8-13(21)25/h9-12H,2-8,19-20H2,1H3,(H2,21,25)(H,22,30)(H,23,29)(H,24,28)(H,26,27)(H,31,32)/t9-,10-,11-,12-/m0/s1 |
InChI Key | SNAKIVFVLVUCKB-BJDJZHNGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H32N6O8 |
Molecular Weight | 460.50 g/mol |
Exact Mass | 460.22816200 g/mol |
Topological Polar Surface Area (TPSA) | 257.00 Ų |
XlogP | -8.30 |
Atomic LogP (AlogP) | -3.26 |
H-Bond Acceptor | 8 |
H-Bond Donor | 8 |
Rotatable Bonds | 16 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.8187 | 81.87% |
Caco-2 | - | 0.9205 | 92.05% |
Blood Brain Barrier | + | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.6746 | 67.46% |
OATP2B1 inhibitior | - | 0.7188 | 71.88% |
OATP1B1 inhibitior | + | 0.9332 | 93.32% |
OATP1B3 inhibitior | + | 0.9450 | 94.50% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.9484 | 94.84% |
P-glycoprotein inhibitior | - | 0.6153 | 61.53% |
P-glycoprotein substrate | + | 0.5803 | 58.03% |
CYP3A4 substrate | + | 0.5450 | 54.50% |
CYP2C9 substrate | - | 0.8043 | 80.43% |
CYP2D6 substrate | - | 0.8228 | 82.28% |
CYP3A4 inhibition | - | 0.9677 | 96.77% |
CYP2C9 inhibition | - | 0.9573 | 95.73% |
CYP2C19 inhibition | - | 0.9461 | 94.61% |
CYP2D6 inhibition | - | 0.9649 | 96.49% |
CYP1A2 inhibition | - | 0.9185 | 91.85% |
CYP2C8 inhibition | - | 0.9177 | 91.77% |
CYP inhibitory promiscuity | - | 0.9891 | 98.91% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8600 | 86.00% |
Carcinogenicity (trinary) | Non-required | 0.7413 | 74.13% |
Eye corrosion | - | 0.9867 | 98.67% |
Eye irritation | - | 0.9616 | 96.16% |
Skin irritation | - | 0.8781 | 87.81% |
Skin corrosion | - | 0.9582 | 95.82% |
Ames mutagenesis | - | 0.7954 | 79.54% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7468 | 74.68% |
Micronuclear | + | 0.5300 | 53.00% |
Hepatotoxicity | - | 0.6863 | 68.63% |
skin sensitisation | - | 0.9381 | 93.81% |
Respiratory toxicity | + | 0.7333 | 73.33% |
Reproductive toxicity | - | 0.6071 | 60.71% |
Mitochondrial toxicity | - | 0.6000 | 60.00% |
Nephrotoxicity | + | 0.5698 | 56.98% |
Acute Oral Toxicity (c) | III | 0.5453 | 54.53% |
Estrogen receptor binding | - | 0.4894 | 48.94% |
Androgen receptor binding | - | 0.5054 | 50.54% |
Thyroid receptor binding | + | 0.5235 | 52.35% |
Glucocorticoid receptor binding | + | 0.6171 | 61.71% |
Aromatase binding | - | 0.5252 | 52.52% |
PPAR gamma | - | 0.5000 | 50.00% |
Honey bee toxicity | - | 0.9332 | 93.32% |
Biodegradation | - | 0.6250 | 62.50% |
Crustacea aquatic toxicity | - | 0.7800 | 78.00% |
Fish aquatic toxicity | - | 0.8947 | 89.47% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.55% | 83.82% |
CHEMBL236 | P41143 | Delta opioid receptor | 98.13% | 99.35% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 97.36% | 90.20% |
CHEMBL2581 | P07339 | Cathepsin D | 97.17% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.16% | 96.09% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 96.66% | 97.23% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 96.34% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.90% | 90.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.47% | 93.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.82% | 99.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.09% | 97.21% |
CHEMBL3776 | Q14790 | Caspase-8 | 93.69% | 97.06% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.68% | 98.33% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.52% | 100.00% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 93.12% | 98.94% |
CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 91.71% | 96.73% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 90.29% | 98.05% |
CHEMBL3018 | Q9Y5Y6 | Matriptase | 90.20% | 98.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.96% | 96.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.18% | 96.47% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 88.97% | 96.28% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 88.92% | 92.32% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.76% | 93.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.99% | 93.10% |
CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 87.95% | 88.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.05% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.72% | 91.11% |
CHEMBL3308 | P55212 | Caspase-6 | 86.64% | 97.56% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 86.04% | 97.86% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 85.48% | 96.67% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.24% | 85.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.06% | 82.69% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 84.77% | 99.17% |
CHEMBL4801 | P29466 | Caspase-1 | 84.76% | 96.85% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.12% | 91.38% |
CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 84.08% | 99.77% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.36% | 96.03% |
CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 83.27% | 92.26% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 83.25% | 92.29% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.13% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.03% | 94.45% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.02% | 94.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.99% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.86% | 91.19% |
CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 82.83% | 95.20% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.38% | 89.50% |
CHEMBL3629 | P68400 | Casein kinase II alpha | 82.15% | 98.89% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.50% | 95.17% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.73% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phytolacca americana |
PubChem | 162964653 |
LOTUS | LTS0046638 |
wikiData | Q105256275 |