Glychalcone B
Internal ID | b6fd0dcd-42a6-4577-bb26-6c1619b1c797 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-(5-hydroxy-7-methoxy-2,2-dimethylchromen-6-yl)prop-2-en-1-one |
SMILES (Canonical) | CC1(C=CC2=C(C(=C(C=C2O1)OC)C(=O)C=CC3=CC(=C(C=C3)OC)OC)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(C(=C(C=C2O1)OC)C(=O)/C=C/C3=CC(=C(C=C3)OC)OC)O)C |
InChI | InChI=1S/C23H24O6/c1-23(2)11-10-15-18(29-23)13-20(28-5)21(22(15)25)16(24)8-6-14-7-9-17(26-3)19(12-14)27-4/h6-13,25H,1-5H3/b8-6+ |
InChI Key | ABLZJMDXNZTQKT-SOFGYWHQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O6 |
Molecular Weight | 396.40 g/mol |
Exact Mass | 396.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 74.20 Ų |
XlogP | 4.70 |
6'',6''-Dimethylpyrano[2'',3'':4',3']-2'-hydroxy-3,4,6'-trimethoxychalcone |
LMPK12120305 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.83% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.01% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.71% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.37% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.81% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.22% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 89.47% | 90.71% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 89.44% | 90.20% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.91% | 95.56% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.59% | 89.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.27% | 95.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.87% | 91.07% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.49% | 89.63% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.94% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.34% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.75% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 81.32% | 98.75% |
CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 81.31% | 83.65% |
CHEMBL290 | Q13370 | Phosphodiesterase 3B | 80.86% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.01% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycosmis parviflora |
PubChem | 15230652 |
LOTUS | LTS0124528 |
wikiData | Q76506574 |