Glyceryl dioleate
Internal ID | 8b66299c-91bb-449f-a76f-9f0e7c5ea189 |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Diradylglycerols > Diacylglycerols > 1,3-diacylglycerols |
IUPAC Name | (2-hydroxy-3-octadec-9-enoyloxypropyl) octadec-9-enoate |
SMILES (Canonical) | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O |
SMILES (Isomeric) | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O |
InChI | InChI=1S/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-35-37(40)36-44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3 |
InChI Key | DRAWQKGUORNASA-UHFFFAOYSA-N |
Popularity | 272 references in papers |
Molecular Formula | C39H72O5 |
Molecular Weight | 621.00 g/mol |
Exact Mass | 620.53797539 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 14.30 |
25637-84-7 |
(2-hydroxy-3-octadec-9-enoyloxypropyl) octadec-9-enoate |
Dioleoylglycerol |
9-Octadecenoic acid (9Z)-, diester with 1,2,3-propanetriol |
Glycerol-1,2- and -1,3-dioleate |
FT-0771410 |
2081110-78-1 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.55% | 99.17% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.49% | 89.63% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.40% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.62% | 98.95% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.35% | 97.29% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 94.24% | 85.94% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.83% | 92.08% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.30% | 96.95% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.28% | 92.86% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.74% | 100.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 85.73% | 98.03% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 84.95% | 97.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.69% | 100.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.03% | 97.21% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.88% | 90.17% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.52% | 91.81% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.45% | 94.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.94% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.92% | 96.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.90% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.17% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.11% | 91.11% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.39% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.13% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brucea javanica |
Sciadopitys verticillata |
PubChem | 33120 |
LOTUS | LTS0148635 |
wikiData | Q104987319 |