Glucodichotomine B
Internal ID | f7dab628-8dc1-49c8-bcda-c99cf7270860 |
Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
IUPAC Name | 1-[(1R)-2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
SMILES (Canonical) | C1=CC=C2C(=C1)C3=CC(=NC(=C3N2)C(CO)OC4C(C(C(C(O4)CO)O)O)O)C(=O)O |
SMILES (Isomeric) | C1=CC=C2C(=C1)C3=CC(=NC(=C3N2)[C@H](CO)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C(=O)O |
InChI | InChI=1S/C20H22N2O9/c23-6-12(30-20-18(27)17(26)16(25)13(7-24)31-20)15-14-9(5-11(22-15)19(28)29)8-3-1-2-4-10(8)21-14/h1-5,12-13,16-18,20-21,23-27H,6-7H2,(H,28,29)/t12-,13+,16+,17-,18+,20+/m0/s1 |
InChI Key | WQKKQBMRVKDLBP-GOPHKZMVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H22N2O9 |
Molecular Weight | 434.40 g/mol |
Exact Mass | 434.13253028 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | -0.90 |
845673-16-7 |
CHEBI:70226 |
HY-N10387 |
CS-0498891 |
E83704 |
Q27138566 |
1-[(1R)-2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.12% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.18% | 96.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.99% | 94.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.25% | 99.17% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 92.17% | 89.44% |
CHEMBL2581 | P07339 | Cathepsin D | 91.96% | 98.95% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 89.96% | 94.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.99% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.18% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.78% | 99.23% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 87.18% | 89.67% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.43% | 96.00% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 84.20% | 95.71% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 84.05% | 97.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.99% | 94.00% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.67% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.60% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.99% | 89.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.20% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stellaria dichotoma |
PubChem | 11154764 |
LOTUS | LTS0153901 |
wikiData | Q27138566 |