Globulixanthone A
Internal ID | e4317d21-e904-4716-86aa-ed74e055d998 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 1,6-dihydroxy-5-methoxy-7-[(1E)-3-methylbuta-1,3-dienyl]xanthen-9-one |
SMILES (Canonical) | CC(=C)C=CC1=CC2=C(C(=C1O)OC)OC3=CC=CC(=C3C2=O)O |
SMILES (Isomeric) | CC(=C)/C=C/C1=CC2=C(C(=C1O)OC)OC3=CC=CC(=C3C2=O)O |
InChI | InChI=1S/C19H16O5/c1-10(2)7-8-11-9-12-17(22)15-13(20)5-4-6-14(15)24-18(12)19(23-3)16(11)21/h4-9,20-21H,1H2,2-3H3/b8-7+ |
InChI Key | HWBGGUSOSGUXJQ-BQYQJAHWSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H16O5 |
Molecular Weight | 324.30 g/mol |
Exact Mass | 324.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 4.80 |
CHEMBL464342 |
1,6-dihydroxy-5-methoxy-7-[(1E)-3-methylbuta-1,3-dienyl]xanthen-9-one |
1,6-Dihydroxy-5-methoxy-7-(3-methyl-buta-1,3-dienyl)-xanthen-9-one |
1,6-dihydroxy-5-methoxy-7-[(1E)-3-methylbuta-1,3-dien-1-yl]-9H-xanthen-9-one |
9H-xanthen-9-one, 1,6-dihydroxy-5-methoxy-7-[(1E)-3-methyl-1,3-butadienyl]- |
InChI=1/C19H16O5/c1-10(2)7-8-11-9-12-17(22)15-13(20)5-4-6-14(15)24-18(12)19(23-3)16(11)21/h4-9,20-21H,1H2,2-3H3/b8-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.35% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.27% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.47% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.09% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.76% | 93.99% |
CHEMBL2581 | P07339 | Cathepsin D | 94.72% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.64% | 86.33% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 92.87% | 98.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.00% | 94.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.95% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.62% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.01% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.45% | 96.00% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 85.62% | 88.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.49% | 98.75% |
CHEMBL3194 | P02766 | Transthyretin | 83.23% | 90.71% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 83.14% | 89.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.60% | 99.17% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.54% | 100.00% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.39% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Symphonia globulifera |
PubChem | 5323527 |
LOTUS | LTS0233801 |
wikiData | Q105034581 |