Glicoricone
Internal ID | 0c6860be-663d-4fb3-8fc5-27450e990962 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
IUPAC Name | 3-[4,6-dihydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]-7-hydroxychromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C(=C(C=C1O)O)C2=COC3=C(C2=O)C=CC(=C3)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C(C=C1O)O)C2=COC3=C(C2=O)C=CC(=C3)O)OC)C |
InChI | InChI=1S/C21H20O6/c1-11(2)4-6-13-16(23)9-17(24)19(21(13)26-3)15-10-27-18-8-12(22)5-7-14(18)20(15)25/h4-5,7-10,22-24H,6H2,1-3H3 |
InChI Key | SSDIPYMSXRNGMZ-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C21H20O6 |
Molecular Weight | 368.40 g/mol |
Exact Mass | 368.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 4.00 |
161099-37-2 |
3-[4,6-dihydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]-7-hydroxychromen-4-one |
CHEMBL4085544 |
CHEBI:175729 |
DTXSID401121041 |
HY-N9329 |
AKOS040761784 |
MS-25896 |
CS-0159470 |
E80598 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.41% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.24% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.57% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.76% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.58% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.32% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.53% | 99.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.21% | 94.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.21% | 99.15% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.17% | 97.28% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.02% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 84.45% | 98.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.85% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 82.00% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.84% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.48% | 90.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.21% | 91.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.36% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.12% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza |
Glycyrrhiza uralensis |
Glycyrrhiza uralensis |
Mitracarpus hirtus |
PubChem | 10361658 |
NPASS | NPC135743 |
LOTUS | LTS0137980 |
wikiData | Q105259609 |