Gliadin
Internal ID | 2dda455e-18fb-4662-9002-bc51ec549be5 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | 5-amino-2-[[1-[5-amino-2-[[1-[2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid |
SMILES (Canonical) | C1CC(N(C1)C(=O)C(CCC(=O)N)NC(=O)C2CCCN2C(=O)C(CC3=CC=C(C=C3)O)N)C(=O)NC(CCC(=O)N)C(=O)O |
SMILES (Isomeric) | C1CC(N(C1)C(=O)C(CCC(=O)N)NC(=O)C2CCCN2C(=O)C(CC3=CC=C(C=C3)O)N)C(=O)NC(CCC(=O)N)C(=O)O |
InChI | InChI=1S/C29H41N7O9/c30-18(15-16-5-7-17(37)8-6-16)27(42)35-13-1-3-21(35)25(40)33-19(9-11-23(31)38)28(43)36-14-2-4-22(36)26(41)34-20(29(44)45)10-12-24(32)39/h5-8,18-22,37H,1-4,9-15,30H2,(H2,31,38)(H2,32,39)(H,33,40)(H,34,41)(H,44,45) |
InChI Key | HZWWPUTXBJEENE-UHFFFAOYSA-N |
Popularity | 3,073 references in papers |
Molecular Formula | C29H41N7O9 |
Molecular Weight | 631.70 g/mol |
Exact Mass | 631.29657591 g/mol |
Topological Polar Surface Area (TPSA) | 269.00 Ų |
XlogP | -4.50 |
Atomic LogP (AlogP) | -2.17 |
H-Bond Acceptor | 9 |
H-Bond Donor | 7 |
Rotatable Bonds | 15 |
9007-90-3 |
Gliadin from Wheat, |
GLIADIN |
5-amino-2-[[1-[5-amino-2-[[1-[2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid |
UNII-GR9478B3Q3 |
EINECS 232-707-7 |
![2D Structure of Gliadin 2D Structure of Gliadin](https://plantaedb.com/storage/docs/compounds/2023/07/gliadin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6155 | 61.55% |
Caco-2 | - | 0.8955 | 89.55% |
Blood Brain Barrier | - | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Mitochondria | 0.7261 | 72.61% |
OATP2B1 inhibitior | - | 0.5801 | 58.01% |
OATP1B1 inhibitior | + | 0.9195 | 91.95% |
OATP1B3 inhibitior | + | 0.9430 | 94.30% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | + | 0.5801 | 58.01% |
P-glycoprotein inhibitior | + | 0.7203 | 72.03% |
P-glycoprotein substrate | + | 0.5000 | 50.00% |
CYP3A4 substrate | + | 0.6174 | 61.74% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7921 | 79.21% |
CYP3A4 inhibition | - | 0.9194 | 91.94% |
CYP2C9 inhibition | - | 0.9482 | 94.82% |
CYP2C19 inhibition | - | 0.8078 | 80.78% |
CYP2D6 inhibition | - | 0.9478 | 94.78% |
CYP1A2 inhibition | - | 0.9514 | 95.14% |
CYP2C8 inhibition | - | 0.8039 | 80.39% |
CYP inhibitory promiscuity | - | 0.9772 | 97.72% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.8700 | 87.00% |
Carcinogenicity (trinary) | Non-required | 0.6308 | 63.08% |
Eye corrosion | - | 0.9923 | 99.23% |
Eye irritation | - | 0.9181 | 91.81% |
Skin irritation | - | 0.7546 | 75.46% |
Skin corrosion | - | 0.9304 | 93.04% |
Ames mutagenesis | - | 0.7900 | 79.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6946 | 69.46% |
Micronuclear | + | 0.7800 | 78.00% |
Hepatotoxicity | + | 0.5392 | 53.92% |
skin sensitisation | - | 0.9120 | 91.20% |
Respiratory toxicity | + | 0.8111 | 81.11% |
Reproductive toxicity | + | 0.9333 | 93.33% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | - | 0.8951 | 89.51% |
Acute Oral Toxicity (c) | III | 0.6274 | 62.74% |
Estrogen receptor binding | + | 0.7184 | 71.84% |
Androgen receptor binding | + | 0.7375 | 73.75% |
Thyroid receptor binding | + | 0.5187 | 51.87% |
Glucocorticoid receptor binding | + | 0.5820 | 58.20% |
Aromatase binding | + | 0.5449 | 54.49% |
PPAR gamma | + | 0.6455 | 64.55% |
Honey bee toxicity | - | 0.8839 | 88.39% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | - | 0.6400 | 64.00% |
Fish aquatic toxicity | - | 0.4919 | 49.19% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.81% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 97.85% | 82.69% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.43% | 100.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 97.32% | 93.10% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 96.41% | 97.93% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 94.06% | 96.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.78% | 91.19% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.13% | 98.33% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 92.63% | 98.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.80% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.72% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.87% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.77% | 95.89% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.77% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.50% | 99.17% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.58% | 83.82% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 89.09% | 99.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.80% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.70% | 90.17% |
CHEMBL2319 | P06870 | Kallikrein 1 | 88.44% | 90.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.99% | 93.56% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 87.11% | 92.29% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.43% | 93.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.14% | 90.71% |
CHEMBL4123 | P30989 | Neurotensin receptor 1 | 85.75% | 96.67% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.33% | 85.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.33% | 95.56% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.03% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.02% | 100.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.90% | 97.64% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.32% | 94.00% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.54% | 82.86% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.70% | 97.21% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.42% | 95.89% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.24% | 95.17% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 80.63% | 83.14% |
CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 80.00% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centipeda minima |
Fagopyrum esculentum |