Glhygfihrknbbp-puooodevsa-
Internal ID | 1f388971-0b65-4d71-aeef-027881f735ab |
Taxonomy | Benzenoids > Anthracenes > Anthracenecarboxylic acids and derivatives > Anthracenecarboxylic acids |
IUPAC Name | 4-hydroxy-10-oxo-9-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracene-2-carboxylic acid |
SMILES (Canonical) | C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2C5C(C(C(C(O5)CO)O)O)O)C=C(C=C4O)C(=O)O |
SMILES (Isomeric) | C1=CC2=C(C(=C1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)C4=C(C2[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C=C(C=C4O)C(=O)O |
InChI | InChI=1S/C27H30O15/c28-6-13-18(31)21(34)23(36)25(40-13)15-9-2-1-3-12(41-27-24(37)22(35)19(32)14(7-29)42-27)17(9)20(33)16-10(15)4-8(26(38)39)5-11(16)30/h1-5,13-15,18-19,21-25,27-32,34-37H,6-7H2,(H,38,39)/t13-,14-,15?,18-,19-,21+,22+,23-,24-,25+,27-/m1/s1 |
InChI Key | GLHYGFIHRKNBBP-PUOOODEVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O15 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 264.00 Ų |
XlogP | -1.50 |
InChI=1/C27H30O15/c28-6-13-18(31)21(34)23(36)25(40-13)15-9-2-1-3-12(41-27-24(37)22(35)19(32)14(7-29)42-27)17(9)20(33)16-10(15)4-8(26(38)39)5-11(16)30/h1-5,13-15,18-19,21-25,27-32,34-37H,6-7H2,(H,38,39)/t13-,14-,15?,18-,19-,21+,22+,23-,24-,25+,27-/m1/s1 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.84% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.16% | 98.95% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.20% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.47% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.33% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.09% | 86.33% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.13% | 83.82% |
CHEMBL3194 | P02766 | Transthyretin | 89.63% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.40% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.36% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.19% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.54% | 94.73% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.40% | 89.67% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.19% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.94% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.07% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rheum officinale |
PubChem | 11972449 |
LOTUS | LTS0222746 |
wikiData | Q105107005 |