Gldxdbqxocjvqc-nnxmzcnrsa-
Internal ID | d6630f0f-e93d-44a6-b1ed-2a91860e9172 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4R,5R)-2-[(2R,3R,4S,5R,6R)-6-(acetyloxymethyl)-3,4-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-5-[(E)-3-[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoyl]oxyoxan-2-yl]oxy-4-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC=C(C=C2)C=CC(=O)OC3C(OC(C(C3OC4C(C(C(C(O4)CO)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)OC6(C(C(C(O6)CO)O)OC(=O)C7=CC=CC=C7)COC(=O)C=CC8=CC(=C(C=C8)O)OC)COC(=O)C)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)/C=C/C(=O)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O[C@]6([C@H]([C@@H]([C@H](O6)CO)O)OC(=O)C7=CC=CC=C7)COC(=O)/C=C/C8=CC(=C(C=C8)O)OC)COC(=O)C)O)O)O |
InChI | InChI=1S/C58H72O32/c1-25-39(66)43(70)46(73)54(80-25)81-30-14-9-27(10-15-30)12-18-38(65)85-49-36(23-78-26(2)62)84-57(51(87-56-48(75)45(72)41(68)34(21-60)83-56)50(49)86-55-47(74)44(71)40(67)33(20-59)82-55)90-58(24-79-37(64)17-13-28-11-16-31(63)32(19-28)77-3)52(42(69)35(22-61)89-58)88-53(76)29-7-5-4-6-8-29/h4-19,25,33-36,39-52,54-57,59-61,63,66-75H,20-24H2,1-3H3/b17-13+,18-12+/t25-,33+,34+,35+,36+,39-,40+,41+,42+,43+,44-,45-,46+,47+,48+,49+,50-,51+,52-,54-,55-,56-,57+,58-/m0/s1 |
InChI Key | GLDXDBQXOCJVQC-NNXMZCNRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H72O32 |
Molecular Weight | 1281.20 g/mol |
Exact Mass | 1280.4006701 g/mol |
Topological Polar Surface Area (TPSA) | 481.00 Ų |
XlogP | -2.10 |
InChI=1/C58H72O32/c1-25-39(66)43(70)46(73)54(80-25)81-30-14-9-27(10-15-30)12-18-38(65)85-49-36(23-78-26(2)62)84-57(51(87-56-48(75)45(72)41(68)34(21-60)83-56)50(49)86-55-47(74)44(71)40(67)33(20-59)82-55)90-58(24-79-37(64)17-13-28-11-16-31(63)32(19-28)77-3) |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 99.60% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.43% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 98.60% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.61% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.90% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.64% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.07% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.74% | 90.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.49% | 97.36% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.93% | 83.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.63% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 88.59% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.02% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.59% | 91.19% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.59% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.76% | 95.50% |
CHEMBL3194 | P02766 | Transthyretin | 85.31% | 90.71% |
CHEMBL5028 | O14672 | ADAM10 | 85.16% | 97.50% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.95% | 89.44% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.30% | 80.78% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.01% | 95.83% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.96% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.38% | 99.15% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.49% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygala myrtifolia |
PubChem | 10942250 |
LOTUS | LTS0219771 |
wikiData | Q105010827 |