Gitostin
Internal ID | 0393201e-8636-40aa-adb9-8d744160851a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | 3-[(3S,5R,8R,9S,10S,13R,14S,16S)-3-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-14,16-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CCC3(C(C2)CCC4C3CCC5(C4(CC(C5C6=CC(=O)OC6)O)O)C)C)O)OC)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(C[C@@H](C5C6=CC(=O)OC6)O)O)C)C)O)OC)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O |
InChI | InChI=1S/C42H66O19/c1-17-34(60-38-32(51)30(49)35(25(15-44)59-38)61-37-31(50)29(48)28(47)24(14-43)58-37)36(54-4)33(52)39(56-17)57-20-7-9-40(2)19(12-20)5-6-22-21(40)8-10-41(3)27(18-11-26(46)55-16-18)23(45)13-42(22,41)53/h11,17,19-25,27-39,43-45,47-53H,5-10,12-16H2,1-4H3/t17-,19-,20+,21+,22-,23+,24-,25-,27?,28-,29+,30-,31-,32-,33-,34+,35-,36-,37+,38+,39+,40+,41-,42+/m1/s1 |
InChI Key | QCLOKNWFEAWYLG-WDEDQDJPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H66O19 |
Molecular Weight | 875.00 g/mol |
Exact Mass | 874.41982987 g/mol |
Topological Polar Surface Area (TPSA) | 293.00 Ų |
XlogP | -2.40 |
11003-88-6 |
BRN 0077953 |
4-18-00-02475 (Beilstein Handbook Reference) |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.34% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.75% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.61% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.99% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.18% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.77% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.97% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.78% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.61% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.60% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.39% | 95.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.34% | 96.43% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.21% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.63% | 97.36% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.38% | 94.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.99% | 92.94% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.73% | 95.93% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.65% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.38% | 92.50% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.20% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.93% | 93.04% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.29% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus integer |
Digitalis cariensis |
PubChem | 133065653 |
LOTUS | LTS0126818 |
wikiData | Q105282055 |