Germerine
Internal ID | d2c61b1a-4b0c-45d1-8659-fc6afb9cb5c5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23R,25R)-10,12,14,16,23-pentahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(CC6C7(C5(C4)OC6(C(CC7)OC(=O)C(C)(CC)O)O)C)O)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@@H]([C@H]2[C@@H](CN3C[C@H](CC[C@H]3[C@@]2(C)O)C)[C@H]4[C@@]1([C@@H]5[C@@H](C[C@H]6[C@]7([C@]5(C4)O[C@]6([C@H](CC7)OC(=O)[C@](C)(CC)O)O)C)O)O)O |
InChI | InChI=1S/C37H59NO11/c1-8-19(4)30(41)48-29-27(40)26-20(17-38-16-18(3)10-11-24(38)34(26,7)44)21-15-35-28(36(21,29)45)22(39)14-23-32(35,5)13-12-25(37(23,46)49-35)47-31(42)33(6,43)9-2/h18-29,39-40,43-46H,8-17H2,1-7H3/t18-,19+,20-,21-,22+,23-,24-,25-,26+,27+,28+,29-,32-,33-,34+,35+,36-,37+/m0/s1 |
InChI Key | JOBMMOBXVRRLOS-BZMUIYTCSA-N |
Popularity | 2 references in papers |
Molecular Formula | C37H59NO11 |
Molecular Weight | 693.90 g/mol |
Exact Mass | 693.40881170 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 2.00 |
Atomic LogP (AlogP) | 1.49 |
H-Bond Acceptor | 12 |
H-Bond Donor | 6 |
Rotatable Bonds | 6 |
UNII-9V3T5CCW5U |
9V3T5CCW5U |
508-67-8 |
Cevane-3,4,7,14,15,16,20-heptol, 4,9-epoxy-, 3-(2-hydroxy-2-methylbutanoate) 15-(2-methylbutanoate), (3beta(S),4alpha,7alpha,15alpha(R),16beta)- |
C37H59NO11 |
Q27273265 |
[(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23R,25R)-10,12,14,16,23-pentahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate |
CEVANE-3,4,7,14,15,16,20-HEPTOL, 4,9-EPOXY-, 3-((2S)-2-HYDROXY-2-METHYLBUTANOATE) 15-((2R)-2-METHYLBUTANOATE), (3.BETA.,4.ALPHA.,7.ALPHA.,15.ALPHA.,16.BETA.)- |
CEVANE-3,4,7,14,15,16,20-HEPTOL, 4,9-EPOXY-, 3-(2-HYDROXY-2-METHYLBUTANOATE) 15-(2-METHYLBUTANOATE), (3.BETA.(S),4.ALPHA.,7.ALPHA.,15.ALPHA.(R),16.BETA.)- |
CEVANE-3.BETA.,4.BETA.,7.ALPHA.,14,15.ALPHA.,16.BETA.,20-HEPTOL, 4,9-EPOXY-, 15-((+)-2-HYDROXY-2-METHYLBUTYRATE) 3-((-)-2-METHYLBUTYRATE) |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6715 | 67.15% |
Caco-2 | - | 0.8495 | 84.95% |
Blood Brain Barrier | + | 0.7250 | 72.50% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Lysosomes | 0.6149 | 61.49% |
OATP2B1 inhibitior | - | 0.7239 | 72.39% |
OATP1B1 inhibitior | + | 0.9055 | 90.55% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | - | 0.4688 | 46.88% |
P-glycoprotein inhibitior | + | 0.7338 | 73.38% |
P-glycoprotein substrate | + | 0.6942 | 69.42% |
CYP3A4 substrate | + | 0.7454 | 74.54% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7867 | 78.67% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9078 | 90.78% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9308 | 93.08% |
CYP1A2 inhibition | - | 0.9425 | 94.25% |
CYP2C8 inhibition | + | 0.7199 | 71.99% |
CYP inhibitory promiscuity | - | 0.9613 | 96.13% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5302 | 53.02% |
Eye corrosion | - | 0.9891 | 98.91% |
Eye irritation | - | 0.9178 | 91.78% |
Skin irritation | - | 0.7598 | 75.98% |
Skin corrosion | - | 0.9349 | 93.49% |
Ames mutagenesis | - | 0.6074 | 60.74% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4448 | 44.48% |
Micronuclear | + | 0.5500 | 55.00% |
Hepatotoxicity | + | 0.5166 | 51.66% |
skin sensitisation | - | 0.8817 | 88.17% |
Respiratory toxicity | + | 0.6778 | 67.78% |
Reproductive toxicity | + | 0.9000 | 90.00% |
Mitochondrial toxicity | + | 0.9750 | 97.50% |
Nephrotoxicity | + | 0.4804 | 48.04% |
Acute Oral Toxicity (c) | I | 0.8149 | 81.49% |
Estrogen receptor binding | + | 0.6638 | 66.38% |
Androgen receptor binding | + | 0.7648 | 76.48% |
Thyroid receptor binding | - | 0.5842 | 58.42% |
Glucocorticoid receptor binding | + | 0.6552 | 65.52% |
Aromatase binding | + | 0.6614 | 66.14% |
PPAR gamma | + | 0.6808 | 68.08% |
Honey bee toxicity | - | 0.6838 | 68.38% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
Fish aquatic toxicity | + | 0.7302 | 73.02% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.96% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.28% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.58% | 96.77% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 97.24% | 89.05% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.70% | 85.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.91% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 93.84% | 98.95% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.55% | 95.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 93.21% | 98.03% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.11% | 97.14% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 92.22% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.75% | 82.69% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 90.88% | 95.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.70% | 97.09% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.69% | 96.47% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.24% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.41% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.29% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.46% | 93.56% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 88.36% | 94.00% |
CHEMBL204 | P00734 | Thrombin | 88.35% | 96.01% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.84% | 98.05% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.57% | 82.50% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.46% | 91.03% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 87.06% | 97.31% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.89% | 92.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.77% | 97.28% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.74% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.40% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.15% | 90.71% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.13% | 96.43% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.06% | 89.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.66% | 100.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.45% | 96.90% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.23% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.09% | 100.00% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 84.40% | 95.27% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.90% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.32% | 89.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.86% | 97.50% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.12% | 98.75% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.11% | 95.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.59% | 91.07% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.36% | 94.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.26% | 95.50% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 80.57% | 88.81% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.32% | 95.71% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.14% | 99.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia lagocephala |
Tanacetum parthenium |