Genistein 5-glucoside
Internal ID | b437bc8f-ddd5-4658-aa35-65ce81e4df63 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 7-hydroxy-3-(4-hydroxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=COC3=C(C2=O)C(=CC(=C3)O)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=COC3=C(C2=O)C(=CC(=C3)O)OC4C(C(C(C(O4)CO)O)O)O)O |
InChI | InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-14-6-11(24)5-13-16(14)17(25)12(8-29-13)9-1-3-10(23)4-2-9/h1-6,8,15,18-24,26-28H,7H2 |
InChI Key | TXLQONQJSWSJJX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O10 |
Molecular Weight | 432.40 g/mol |
Exact Mass | 432.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.30 |
CHEBI:176087 |
7-hydroxy-3-(4-hydroxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.55% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.45% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.69% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.91% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.26% | 96.21% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.62% | 86.92% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.95% | 95.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.13% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 86.46% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.47% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.10% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.68% | 95.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.03% | 91.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.45% | 95.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.66% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.55% | 99.15% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.88% | 95.89% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.49% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chaenomeles sinensis |
Prunus cerasus |
PubChem | 14583642 |
LOTUS | LTS0082249 |
wikiData | Q105266837 |