Gemin A
Internal ID | f0402e93-d3a2-47ae-9346-83a46b069510 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1R,2S,19R,20R,22R)-7,8,9,12,13,14,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-20-yl] 2-[5-[[(10R,11S,12R,13R,15R)-3,4,5,21,22,23-hexahydroxy-8,18-dioxo-11,12-bis[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-13-yl]oxycarbonyl]-2,3-dihydroxyphenoxy]-3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4OC5=CC(=CC(=C5O)O)C(=O)OC6C(C(C7C(O6)COC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O7)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O3)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@H]3[C@H]([C@H](O2)OC(=O)C4=CC(=C(C(=C4OC5=CC(=CC(=C5O)O)C(=O)O[C@@H]6[C@@H]([C@H]([C@H]7[C@H](O6)COC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O7)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O3)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C82H56O52/c83-26-1-16(2-27(84)47(26)95)71(112)129-67-65-39(14-122-74(115)19-7-31(88)50(98)57(105)41(19)43-21(76(117)127-65)9-33(90)52(100)59(43)107)125-81(69(67)131-72(113)17-3-28(85)48(96)29(86)4-17)133-73(114)18-5-30(87)49(97)38(6-18)124-64-25(13-37(94)56(104)63(64)111)80(121)134-82-70-68(130-78(119)23-11-35(92)54(102)61(109)45(23)46-24(79(120)132-70)12-36(93)55(103)62(46)110)66-40(126-82)15-123-75(116)20-8-32(89)51(99)58(106)42(20)44-22(77(118)128-66)10-34(91)53(101)60(44)108/h1-13,39-40,65-70,81-111H,14-15H2/t39-,40-,65-,66-,67+,68+,69-,70-,81-,82-/m1/s1 |
InChI Key | ODXMIHPUPFEYDB-HISCDKSNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C82H56O52 |
Molecular Weight | 1873.30 g/mol |
Exact Mass | 1872.1737620 g/mol |
Topological Polar Surface Area (TPSA) | 877.00 Ų |
XlogP | 4.50 |
CHEBI:5297 |
Q27106708 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.91% | 95.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.76% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.25% | 83.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.03% | 97.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.36% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 90.26% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.13% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.07% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.96% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.61% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.36% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.27% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.53% | 99.23% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.43% | 96.95% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.70% | 94.42% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.51% | 83.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.49% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.45% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.16% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.96% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.53% | 97.09% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 82.52% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.20% | 91.19% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.59% | 94.73% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 81.53% | 100.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.33% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.22% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.11% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Geum aleppicum |
PubChem | 16129624 |
LOTUS | LTS0068739 |
wikiData | Q27106708 |