Furo(2,3-b)quinolin-7-ol, 4-methoxy-8-(3-methyl-2-butenyl)-
| Internal ID | c5b88dbb-33a9-4c98-b720-7bc162138a4b |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | 4-methoxy-8-(3-methylbut-2-enyl)furo[2,3-b]quinolin-7-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H17NO3/c1-10(2)4-5-11-14(19)7-6-12-15(11)18-17-13(8-9-21-17)16(12)20-3/h4,6-9,19H,5H2,1-3H3 |
| InChI Key | IANYLUHPTIWWLS-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.12084340 g/mol |
| Topological Polar Surface Area (TPSA) | 55.50 Ų |
| XlogP | 4.50 |
| 107882-26-8 |
| 7-Hydroxy-8-(3-methyl-2-butenyl)-4-methoxyfuro(2,3-b)quinoline |
| 4-methoxy-8-(3-methylbut-2-enyl)furo(2,3-b)quinolin-7-ol |
| 4-methoxy-8-(3-methylbut-2-enyl)furo[2,3-b]quinolin-7-ol |
| RefChem:345892 |
| CHEMBL447095 |
| DTXSID70910566 |
| 4-Methoxy-8-(3-methylbut-2-en-1-yl)furo[2,3-b]quinolin-7(9H)-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.83% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.62% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.85% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.71% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.95% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.21% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.73% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.25% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.06% | 83.82% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.67% | 94.03% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.11% | 85.30% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.01% | 95.56% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 81.23% | 97.88% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.17% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum tuberculatum |
| PubChem | 135743956 |
| LOTUS | LTS0035315 |
| wikiData | Q105036201 |