Fraxiresinol
Internal ID | e418f6f3-7209-43ae-8b74-b271cf3ee3d4 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | (3R,3aS,6S,6aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C3(COC(C3CO2)C4=CC(=C(C=C4)O)OC)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@]3(CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)O |
InChI | InChI=1S/C21H24O8/c1-25-15-6-11(4-5-14(15)22)19-13-9-28-20(21(13,24)10-29-19)12-7-16(26-2)18(23)17(8-12)27-3/h4-8,13,19-20,22-24H,9-10H2,1-3H3/t13-,19-,20-,21-/m1/s1 |
InChI Key | IIWORNRJBHZPOA-PJBPFLDMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H24O8 |
Molecular Weight | 404.40 g/mol |
Exact Mass | 404.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 1.20 |
89199-97-3 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.23% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.20% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.50% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.49% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.08% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.97% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.88% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.43% | 92.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.33% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.98% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.46% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.99% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.79% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.74% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.94% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fraxinus chinensis subsp. rhynchophylla |
Fraxinus mandshurica |
Gentiana lutea |
Salvia santolinifolia |
Salvia trijuga |
PubChem | 21632950 |
LOTUS | LTS0089639 |
wikiData | Q104399843 |